N-(5-((4-cyclopropylpiperazin-1-yl)methyl)pyridin-2-yl)-5-fluoro-4-(5-fluoro-1,1-dimethyl-2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)pyrimidin-2-amine

ID: ALA4207451

PubChem CID: 129102577

Max Phase: Preclinical

Molecular Formula: C29H32F2N8

Molecular Weight: 530.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CCc2nc3c(F)cc(-c4nc(Nc5ccc(CN6CCN(C7CC7)CC6)cn5)ncc4F)cc3n21

Standard InChI:  InChI=1S/C29H32F2N8/c1-29(2)8-7-25-35-27-21(30)13-19(14-23(27)39(25)29)26-22(31)16-33-28(36-26)34-24-6-3-18(15-32-24)17-37-9-11-38(12-10-37)20-4-5-20/h3,6,13-16,20H,4-5,7-12,17H2,1-2H3,(H,32,33,34,36)

Standard InChI Key:  FOHJPPOWZXGQDX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 45  0  0  0  0  0  0  0  0999 V2000
   16.0767  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7912  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5057  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5057  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7912  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0767  -14.1363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3623  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9266  -10.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2622  -11.5218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6491  -12.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9346  -11.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1061  -10.8544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0982   -9.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3837   -9.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7706  -10.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2202  -12.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2202  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9346  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6491  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0561  -10.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2857   -9.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3636  -13.3113    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.2202  -14.5488    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.6478  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6478  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9333  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2189  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2189  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9333  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5044  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7899  -14.1363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0754  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3610  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3610  -13.3113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0754  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7899  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6465  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8215  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2340  -12.1844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 12  1  0
 13 14  1  0
 14 15  1  0
 12 15  1  0
  8 13  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 10 19  2  0
 11 16  2  0
 15 20  1  0
 15 21  1  0
 19 22  1  0
  3 17  1  0
  4 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 31 36  1  0
 37 38  1  0
 38 39  1  0
 37 39  1  0
 34 37  1  0
 30 31  1  0
 27 30  1  0
  7 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4207451

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4 (2749 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK1 Tchem Cyclin-dependent kinase 1/ G1/S-specific cyclin-D3 (24 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK6 Tclin Cyclin-dependent kinase 6 (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.63Molecular Weight (Monoisotopic): 530.2718AlogP: 4.87#Rotatable Bonds: 6
Polar Surface Area: 75.00Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.27CX Basic pKa: 7.76CX LogP: 4.67CX LogD: 4.16
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.38Np Likeness Score: -1.19

References

1. Wang Y, Liu WJ, Yin L, Li H, Chen ZH, Zhu DX, Song XQ, Cheng ZZ, Song P, Wang Z, Li ZG..  (2018)  Design and synthesis of 4-(2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)-N-(5-(piperazin-1-ylmethyl)pyridine-2-yl)pyrimidin-2-amine as a highly potent and selective cyclin-dependent kinases 4 and 6 inhibitors and the discovery of structure-activity relationships.,  28  (5): [PMID:29429832] [10.1016/j.bmcl.2017.12.068]

Source