The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-amino-6-(1-methyl-1H-pyrazol-4-ylamino)-1,3,5-triazin-2-yl)-2-(hydroxymethyl)phenyl)-6-cyclopropyl-8-fluoroisoquinolin-1(2H)-one sulfate ID: ALA4207531
PubChem CID: 121362176
Max Phase: Preclinical
Molecular Formula: C26H25FN8O6S
Molecular Weight: 498.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(Nc2nc(N)nc(-c3cccc(-n4ccc5cc(C6CC6)cc(F)c5c4=O)c3CO)n2)cn1.O=S(=O)(O)O
Standard InChI: InChI=1S/C26H23FN8O2.H2O4S/c1-34-12-17(11-29-34)30-26-32-23(31-25(28)33-26)18-3-2-4-21(19(18)13-36)35-8-7-15-9-16(14-5-6-14)10-20(27)22(15)24(35)37;1-5(2,3)4/h2-4,7-12,14,36H,5-6,13H2,1H3,(H3,28,30,31,32,33);(H2,1,2,3,4)
Standard InChI Key: RGIPSTHMPKGWBL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
8.3659 -15.9311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7786 -16.6410 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.1870 -15.9286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0729 -17.0537 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4886 -17.0456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9258 -11.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9246 -12.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6327 -12.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3423 -12.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3395 -11.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6309 -11.0194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2166 -12.6558 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0472 -12.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0471 -13.4723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7546 -13.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4627 -13.4700 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4588 -12.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7507 -12.2449 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6325 -13.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1644 -12.2364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.8742 -12.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7555 -14.6969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9247 -13.8824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5129 -12.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5094 -13.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2215 -13.4694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5174 -11.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8021 -13.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8107 -12.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1105 -12.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4013 -12.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3966 -13.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0974 -13.8644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1182 -11.4194 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6848 -13.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8676 -13.8561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2724 -14.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9676 -13.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7677 -13.6162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1728 -12.9063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6228 -12.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9850 -12.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
7 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 13 1 0
8 19 1 0
17 20 1 0
20 21 1 0
15 22 1 0
19 23 1 0
12 24 1 0
12 26 1 0
24 29 1 0
28 25 1 0
25 26 2 0
24 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
30 34 1 0
36 35 1 0
37 36 1 0
35 37 1 0
32 35 1 0
21 38 1 0
38 39 2 0
39 40 1 0
40 41 1 0
41 21 2 0
40 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.52Molecular Weight (Monoisotopic): 498.1928AlogP: 3.41#Rotatable Bonds: 6Polar Surface Area: 136.77Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.23CX Basic pKa: 5.22CX LogP: 3.83CX LogD: 3.82Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.32Np Likeness Score: -1.21
References 1. Kawahata W, Asami T, Kiyoi T, Irie T, Taniguchi H, Asamitsu Y, Inoue T, Miyake T, Sawa M.. (2018) Design and Synthesis of Novel Amino-triazine Analogues as Selective Bruton's Tyrosine Kinase Inhibitors for Treatment of Rheumatoid Arthritis., 61 (19): [PMID:30216722 ] [10.1021/acs.jmedchem.8b01147 ]