N-(1-(3,4-Difluorobenzyl)-1H-pyrazol-3-yl)-2-(3-methyl-2-oxo-2,3-dihydrobenzo[d]oxazol-6-yl)acetamide

ID: ALA4207979

PubChem CID: 126740650

Max Phase: Preclinical

Molecular Formula: C20H16F2N4O3

Molecular Weight: 398.37

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(=O)oc2cc(CC(=O)Nc3ccn(Cc4ccc(F)c(F)c4)n3)ccc21

Standard InChI:  InChI=1S/C20H16F2N4O3/c1-25-16-5-3-12(9-17(16)29-20(25)28)10-19(27)23-18-6-7-26(24-18)11-13-2-4-14(21)15(22)8-13/h2-9H,10-11H2,1H3,(H,23,24,27)

Standard InChI Key:  IIXYZDSTCZPGGD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   10.1426  -16.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4380  -16.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7225  -16.2090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4640  -15.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6427  -15.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3883  -16.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0554  -16.6910    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6810  -16.6209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9684  -16.2095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2574  -16.6236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5489  -16.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8395  -16.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8414  -14.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5506  -15.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9668  -15.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8525  -16.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5567  -16.1856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5474  -15.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8281  -14.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1269  -15.3842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2497  -14.9476    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.2690  -16.5861    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.1266  -16.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1254  -15.3986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3397  -15.1446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8554  -15.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3417  -16.4804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0861  -14.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0382  -15.8146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  3  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 23  1  0
 24 13  1  0
 13 14  2  0
 14 11  1  0
  9 15  2  0
  1 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  1  1  0
 18 21  1  0
 17 22  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 25 28  1  0
 26 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4207979

    ---

Associated Targets(Human)

CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1I Tclin Voltage-gated T-type calcium channel alpha-1I subunit (425 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.37Molecular Weight (Monoisotopic): 398.1190AlogP: 2.84#Rotatable Bonds: 5
Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.30CX Basic pKa: 1.06CX LogP: 3.30CX LogD: 3.30
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.56Np Likeness Score: -2.34

References

1. Bezençon O, Heidmann B, Siegrist R, Stamm S, Richard S, Pozzi D, Corminboeuf O, Roch C, Kessler M, Ertel EA, Reymond I, Pfeifer T, de Kanter R, Toeroek-Schafroth M, Moccia LG, Mawet J, Moon R, Rey M, Capeleto B, Fournier E..  (2017)  Discovery of a Potent, Selective T-type Calcium Channel Blocker as a Drug Candidate for the Treatment of Generalized Epilepsies.,  60  (23): [PMID:29116786] [10.1021/acs.jmedchem.7b01236]

Source