1-(3-ethoxyphenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine

ID: ALA4208060

PubChem CID: 145976460

Max Phase: Preclinical

Molecular Formula: C24H32N2O5

Molecular Weight: 428.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1cccc(N2CCN(CC(O)COc3ccc(CC(=O)OC)cc3)CC2)c1

Standard InChI:  InChI=1S/C24H32N2O5/c1-3-30-23-6-4-5-20(16-23)26-13-11-25(12-14-26)17-21(27)18-31-22-9-7-19(8-10-22)15-24(28)29-2/h4-10,16,21,27H,3,11-15,17-18H2,1-2H3

Standard InChI Key:  FUDURQYKPKGBHO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   13.2429   -9.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2417  -10.3163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9498  -10.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6594  -10.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6566   -9.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9480   -9.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9455   -8.2707    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6520   -7.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3609   -8.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0674   -7.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3634   -9.0836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7764   -8.2622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7732   -9.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4781   -9.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1870   -9.0756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1865   -8.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4771   -7.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8930   -9.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8910  -10.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5976  -10.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3066  -10.3036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3046   -9.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5975   -9.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9496  -11.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2418  -11.9508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2416  -12.7680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5341  -11.5421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8263  -11.9505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5966  -11.5289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8883  -11.9366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8873  -12.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  3 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 20 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4208060

    ---

Associated Targets(non-human)

Thoracic aorta (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 2.36#Rotatable Bonds: 10
Polar Surface Area: 71.47Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.45CX LogP: 2.92CX LogD: 2.60
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -1.22

References

1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M..  (2018)  Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes.,  28  (4): [PMID:29422390] [10.1016/j.bmcl.2018.01.068]

Source