The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-ethoxyphenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine ID: ALA4208060
PubChem CID: 145976460
Max Phase: Preclinical
Molecular Formula: C24H32N2O5
Molecular Weight: 428.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1cccc(N2CCN(CC(O)COc3ccc(CC(=O)OC)cc3)CC2)c1
Standard InChI: InChI=1S/C24H32N2O5/c1-3-30-23-6-4-5-20(16-23)26-13-11-25(12-14-26)17-21(27)18-31-22-9-7-19(8-10-22)15-24(28)29-2/h4-10,16,21,27H,3,11-15,17-18H2,1-2H3
Standard InChI Key: FUDURQYKPKGBHO-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
13.2429 -9.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2417 -10.3163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9498 -10.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6594 -10.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6566 -9.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9480 -9.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9455 -8.2707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6520 -7.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3609 -8.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0674 -7.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3634 -9.0836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7764 -8.2622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7732 -9.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4781 -9.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1870 -9.0756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.1865 -8.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4771 -7.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8930 -9.4843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8910 -10.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5976 -10.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3066 -10.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3046 -9.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5975 -9.0768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9496 -11.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2418 -11.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2416 -12.7680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.5341 -11.5421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8263 -11.9505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5966 -11.5289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8883 -11.9366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8873 -12.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
3 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
20 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2311AlogP: 2.36#Rotatable Bonds: 10Polar Surface Area: 71.47Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.45CX LogP: 2.92CX LogD: 2.60Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.58Np Likeness Score: -1.22
References 1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M.. (2018) Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes., 28 (4): [PMID:29422390 ] [10.1016/j.bmcl.2018.01.068 ]