Piceatannol 3'-O-(6\"-4-hydroxybenzoyl)-beta-D-glucopyranoside

ID: ALA4209002

PubChem CID: 145965862

Max Phase: Preclinical

Molecular Formula: C27H26O11

Molecular Weight: 526.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(OC[C@H]1O[C@@H](Oc2cc(/C=C/c3cc(O)cc(O)c3)ccc2O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(O)cc1

Standard InChI:  InChI=1S/C27H26O11/c28-17-6-4-16(5-7-17)26(35)36-13-22-23(32)24(33)25(34)27(38-22)37-21-11-14(3-8-20(21)31)1-2-15-9-18(29)12-19(30)10-15/h1-12,22-25,27-34H,13H2/b2-1+/t22-,23-,24+,25-,27-/m1/s1

Standard InChI Key:  JMAQDFOBYNEOAV-ODXJXHFHSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.5151  -19.6676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3177  -21.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5743  -20.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3364  -19.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0386  -16.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8117  -19.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4469  -21.1579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1062  -17.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0912  -20.3808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7415  -20.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1918  -14.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3347  -16.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5115  -16.7821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7496  -17.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2779  -17.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7431  -16.0439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8211  -16.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2337  -18.9899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4638  -19.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9941  -16.7579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.1123  -18.9332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7910  -15.3259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5846  -17.4805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0417  -20.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9941  -19.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4693  -18.2865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4409  -15.3027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2168  -20.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5211  -18.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4928  -21.0972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0549  -19.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0135  -14.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3409  -18.2063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4142  -13.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0951  -16.0713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2166  -16.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2381  -17.4677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2685  -20.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 26 31  1  0
 25  6  1  0
  9  1  2  0
 32 11  1  0
 24  7  1  0
 12 14  1  0
 36  5  2  0
 33 29  1  0
 32 34  1  0
  8 15  1  6
  1  4  1  0
 24 19  2  0
 12 16  1  6
 20 23  1  0
  8 13  1  0
 30  2  2  0
 29  8  1  0
 20 17  1  0
 11 22  2  0
  4 10  2  0
 17 37  2  0
  2 10  1  0
 13 12  1  0
 22 36  1  0
 18 31  2  0
 13 35  1  1
  5 27  1  0
 10  3  1  0
 29 21  1  1
 27 32  2  0
  6 18  1  0
 17 36  1  0
 24 28  1  0
 21  1  1  0
  9 30  1  0
  3 25  2  0
 19 31  1  0
 14 23  1  1
 14 33  1  0
 28  6  2  0
  9 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4209002

    ---

Associated Targets(Human)

ESR2 Tclin Estrogen receptor (3070 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.49Molecular Weight (Monoisotopic): 526.1475AlogP: 1.72#Rotatable Bonds: 7
Polar Surface Area: 186.37Molecular Species: NEUTRALHBA: 11HBD: 7
#RO5 Violations: 3HBA (Lipinski): 11HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 8.23CX Basic pKa: CX LogP: 3.02CX LogD: 2.96
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: 1.39

References

1. Park S, Kim YN, Kwak HJ, Jeong EJ, Kim SH..  (2018)  Estrogenic activity of constituents from the rhizomes of Rheum undulatum Linné.,  28  (4): [PMID:29402747] [10.1016/j.bmcl.2018.01.063]

Source