The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-cyclopropyl-6-fluoro-4-oxo-7-(4-((5-(2-oxo-2-phenylethylthio)-1,3,4-oxadiazol-2-yl)methyl)piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4209112
PubChem CID: 145967061
Max Phase: Preclinical
Molecular Formula: C28H26FN5O5S
Molecular Weight: 563.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nnc(CN2CCN(c3cc4c(cc3F)c(=O)c(C(=O)O)cn4C3CC3)CC2)o1)c1ccccc1
Standard InChI: InChI=1S/C28H26FN5O5S/c29-21-12-19-22(34(18-6-7-18)14-20(26(19)36)27(37)38)13-23(21)33-10-8-32(9-11-33)15-25-30-31-28(39-25)40-16-24(35)17-4-2-1-3-5-17/h1-5,12-14,18H,6-11,15-16H2,(H,37,38)
Standard InChI Key: JHTUKWVELYLRCK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
25.9341 -9.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9329 -9.9737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6410 -10.3827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6392 -8.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3478 -9.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3466 -9.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0567 -10.3871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7726 -9.9778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7738 -9.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0591 -8.7367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4826 -8.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1893 -9.1555 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4846 -7.9280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0591 -7.9195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2263 -8.7457 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.2262 -10.3834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5189 -9.9720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8130 -10.3766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8082 -11.1941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5154 -11.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2275 -11.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0582 -11.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6476 -11.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4648 -11.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0986 -11.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3928 -11.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3082 -10.3777 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5097 -10.2041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0978 -10.9100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6419 -11.5197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2847 -10.9918 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.8074 -10.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9943 -10.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5169 -9.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6585 -11.1553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8565 -9.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3798 -8.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5658 -8.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2308 -9.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7095 -9.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
11 12 1 0
11 13 2 0
9 11 1 0
10 14 2 0
1 15 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
2 16 1 0
23 22 1 0
24 23 1 0
22 24 1 0
7 22 1 0
19 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 26 1 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.61Molecular Weight (Monoisotopic): 563.1639AlogP: 3.85#Rotatable Bonds: 9Polar Surface Area: 121.77Molecular Species: ACIDHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 5.87CX Basic pKa: 3.45CX LogP: 2.95CX LogD: 1.41Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -1.62
References 1. Kassab AE, Gedawy EM.. (2018) Novel ciprofloxacin hybrids using biology oriented drug synthesis (BIODS) approach: Anticancer activity, effects on cell cycle profile, caspase-3 mediated apoptosis, topoisomerase II inhibition, and antibacterial activity., 150 [PMID:29547830 ] [10.1016/j.ejmech.2018.03.026 ]