The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1-(2-(dimethylamino)-2-methylpropanoyl)-3-((4-((2-methylquinolin-4-yl)methoxy)phenyl)sulfonamido)azetidin-3-yl)-N-hydroxyacetamide ID: ALA4209541
PubChem CID: 130273554
Max Phase: Preclinical
Molecular Formula: C28H35N5O6S
Molecular Weight: 569.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(COc2ccc(S(=O)(=O)NC3(CC(=O)NO)CN(C(=O)C(C)(C)N(C)C)C3)cc2)c2ccccc2n1
Standard InChI: InChI=1S/C28H35N5O6S/c1-19-14-20(23-8-6-7-9-24(23)29-19)16-39-21-10-12-22(13-11-21)40(37,38)31-28(15-25(34)30-36)17-33(18-28)26(35)27(2,3)32(4)5/h6-14,31,36H,15-18H2,1-5H3,(H,30,34)
Standard InChI Key: CAWAGNVJSKTWIV-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
16.2572 -22.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8527 -21.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4437 -22.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1552 -19.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5732 -19.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1510 -20.4032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7330 -19.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9835 -19.9345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5791 -19.2288 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.1701 -19.9319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5457 -18.7936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2537 -19.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9675 -18.7931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9647 -17.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5468 -17.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2509 -17.5622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2489 -16.7464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5436 -16.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8347 -16.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8402 -17.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5401 -15.5160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1306 -17.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4165 -17.5765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7070 -17.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9968 -17.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2877 -17.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2919 -18.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0110 -19.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7171 -18.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8724 -18.8248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4487 -18.8346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7398 -19.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0251 -18.8445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7455 -20.0736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0194 -18.0232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1481 -21.2203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4390 -21.6264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5635 -21.2254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2698 -21.6365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5664 -20.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 4 1 0
9 8 2 0
10 9 2 0
15 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 16 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 9 1 0
9 30 1 0
30 4 1 0
4 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
6 36 1 0
36 37 2 0
36 2 1 0
2 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 569.68Molecular Weight (Monoisotopic): 569.2308AlogP: 2.22#Rotatable Bonds: 10Polar Surface Area: 141.17Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.94CX Basic pKa: 8.05CX LogP: 1.10CX LogD: 0.71Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.96
References 1. Boiteau JG, Ouvry G, Arlabosse JM, Astri S, Beillard A, Bhurruth-Alcor Y, Bonnary L, Bouix-Peter C, Bouquet K, Bourotte M, Cardinaud I, Comino C, Deprez B, Duvert D, Féret A, Hacini-Rachinel F, Harris CS, Luzy AP, Mathieu A, Millois C, Orsini N, Pascau J, Pinto A, Piwnica D, Polge G, Reitz A, Reversé K, Rodeville N, Rossio P, Spiesse D, Tabet S, Taquet N, Tomas L, Vial E, Hennequin LF.. (2018) Discovery and process development of a novel TACE inhibitor for the topical treatment of psoriasis., 26 (4): [PMID:28818461 ] [10.1016/j.bmc.2017.07.054 ]