4-(2-(2-Cyano-4-methyl-5-((4-((6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)methyl)-1H-indol-1-yl)ethyl)-N-methylpiperazine-1-sulfonamide

ID: ALA4209696

PubChem CID: 117636547

Max Phase: Preclinical

Molecular Formula: C31H38F3N9O2S2

Molecular Weight: 689.83

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNS(=O)(=O)N1CCN(CCn2c(C#N)cc3c(C)c(CN4CCC(Nc5ncnc6sc(CC(F)(F)F)cc56)CC4)ccc32)CC1

Standard InChI:  InChI=1S/C31H38F3N9O2S2/c1-21-22(3-4-28-26(21)15-24(18-35)43(28)14-11-40-9-12-42(13-10-40)47(44,45)36-2)19-41-7-5-23(6-8-41)39-29-27-16-25(17-31(32,33)34)46-30(27)38-20-37-29/h3-4,15-16,20,23,36H,5-14,17,19H2,1-2H3,(H,37,38,39)

Standard InChI Key:  VFROXLJZEGBDON-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 47 52  0  0  0  0  0  0  0  0999 V2000
   44.1490   -1.9192    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9662   -1.9192    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   44.5576   -1.2115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8494   -4.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8483   -5.0210    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5563   -5.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5545   -3.7926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2590   -4.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2597   -5.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0480   -5.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5253   -4.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0402   -3.9404    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.3425   -4.5950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7469   -3.8849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5641   -3.8801    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.3342   -3.1796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   42.1473   -3.1738    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5574   -6.2513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2615   -6.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2611   -7.4711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9653   -7.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6749   -7.4726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.6758   -6.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9671   -6.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3816   -7.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0903   -7.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7946   -7.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7937   -6.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0883   -6.6633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7906   -8.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5053   -6.6650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5033   -7.4810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2787   -7.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7601   -7.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2820   -6.4149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.5770   -7.0737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3942   -7.0757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.2769   -5.5965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9821   -5.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9770   -4.3663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.6817   -3.9591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6785   -3.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9701   -2.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.2631   -3.1493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2646   -3.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6748   -1.5099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.3825   -1.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
  6 18  1  0
 18 19  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 22 25  1  0
 25 26  1  0
 26 27  2  0
 27 32  1  0
 31 28  1  0
 28 29  2  0
 29 26  1  0
 27 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 31  1  0
 36 37  3  0
 34 36  1  0
 35 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 40 45  1  0
 41 42  1  0
 42 43  1  0
 43 44  1  0
 44 45  1  0
 43  2  1  0
  2 46  1  0
 46 47  1  0
M  END

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Men1 Menin (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 689.83Molecular Weight (Monoisotopic): 689.2542AlogP: 4.09#Rotatable Bonds: 10
Polar Surface Area: 122.42Molecular Species: BASEHBA: 10HBD: 2
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.56CX Basic pKa: 8.75CX LogP: 3.36CX LogD: 1.95
Aromatic Rings: 4Heavy Atoms: 47QED Weighted: 0.26Np Likeness Score: -1.76

References

1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J..  (2018)  Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction.,  61  (11): [PMID:29738674] [10.1021/acs.jmedchem.8b00071]

Source