The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-3-(5-Ethylthiophen-2-yl)-2-(5-(pyridin-2-yl)pyrimidin-2-yl)-1,2,3,4-tetrahydro-9H-pyrrolo[3,4-b]quinolin-9-one ID: ALA4209716
PubChem CID: 141492968
Max Phase: Preclinical
Molecular Formula: C26H21N5OS
Molecular Weight: 451.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(C2c3[nH]c4ccccc4c(=O)c3CN2c2ncc(-c3ccccn3)cn2)s1
Standard InChI: InChI=1S/C26H21N5OS/c1-2-17-10-11-22(33-17)24-23-19(25(32)18-7-3-4-9-21(18)30-23)15-31(24)26-28-13-16(14-29-26)20-8-5-6-12-27-20/h3-14,24H,2,15H2,1H3,(H,30,32)
Standard InChI Key: IFMLEMDUMAPODC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
21.7532 -20.6361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7521 -21.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4601 -21.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4583 -20.2272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1669 -20.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1658 -21.4531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8720 -21.8622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8743 -20.2209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5850 -20.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5858 -21.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3643 -21.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8447 -21.0424 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3630 -20.3809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8743 -19.4037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6602 -21.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0689 -21.7504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8853 -21.7499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2940 -21.0412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8803 -20.3316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0652 -20.3356 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6210 -22.4789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1413 -23.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6223 -23.8012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3993 -23.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3984 -22.7307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
29.1069 -21.0385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5166 -21.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3330 -21.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7408 -21.0361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3261 -20.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5111 -20.3320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0609 -24.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9763 -24.8403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 9 1 0
8 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 21 1 0
11 21 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
18 26 1 0
24 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.56Molecular Weight (Monoisotopic): 451.1467AlogP: 5.11#Rotatable Bonds: 4Polar Surface Area: 74.77Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.40CX Basic pKa: 3.99CX LogP: 5.70CX LogD: 5.70Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.41Np Likeness Score: -0.89
References 1. Zheng H, Li L, Sun B, Gao Y, Song W, Zhao X, Gao Y, Xie Z, Zhang N, Ji J, Yuan H, Lou H.. (2018) Design and synthesis of furyl/thineyl pyrroloquinolones based on natural alkaloid perlolyrine, lead to the discovery of potent and selective PDE5 inhibitors., 150 [PMID:29505934 ] [10.1016/j.ejmech.2018.02.039 ] 2. Zheng H, Wu Y, Sun B, Cheng C, Qiao Y, Jiang Y, Zhao S, Xie Z, Tan J, Lou H.. (2018) Discovery of furyl/thienyl β-carboline derivatives as potent and selective PDE5 inhibitors with excellent vasorelaxant effect., 158 [PMID:30245400 ] [10.1016/j.ejmech.2018.09.028 ]