The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-Methyl-1-(2-(4-propionylpiperazin-1-yl)ethyl)-5-((4-((6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)-methyl)-1H-indole-2-carbonitrile ID: ALA4210021
PubChem CID: 117636594
Max Phase: Preclinical
Molecular Formula: C33H39F3N8OS
Molecular Weight: 652.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N1CCN(CCn2c(C#N)cc3c(C)c(CN4CCC(Nc5ncnc6sc(CC(F)(F)F)cc56)CC4)ccc32)CC1
Standard InChI: InChI=1S/C33H39F3N8OS/c1-3-30(45)43-13-10-41(11-14-43)12-15-44-25(19-37)16-27-22(2)23(4-5-29(27)44)20-42-8-6-24(7-9-42)40-31-28-17-26(18-33(34,35)36)46-32(28)39-21-38-31/h4-5,16-17,21,24H,3,6-15,18,20H2,1-2H3,(H,38,39,40)
Standard InChI Key: CUUAMNOCGMUEBO-UHFFFAOYSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
20.4036 -18.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4025 -19.2434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1105 -19.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1087 -18.0150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8132 -18.4203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8139 -19.2389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6022 -19.4874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0795 -18.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5944 -18.1629 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.8967 -18.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3011 -18.1073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1183 -18.1025 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.8884 -17.4020 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.7015 -17.3963 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.1116 -20.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8157 -20.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8153 -21.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5195 -22.1011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2291 -21.6951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2300 -20.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5213 -20.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9358 -22.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6445 -21.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3488 -22.1117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3479 -20.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6425 -20.8858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3448 -22.9289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0595 -20.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0575 -21.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8329 -21.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3143 -21.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8362 -20.6373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1312 -21.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9484 -21.2981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8311 -19.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5363 -19.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5312 -18.5888 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2359 -18.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2327 -17.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5243 -16.9599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8173 -17.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8188 -18.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5223 -16.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2290 -15.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8136 -15.7359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.9377 -16.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
11 14 1 0
3 15 1 0
15 16 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
23 24 2 0
24 29 1 0
28 25 1 0
25 26 2 0
26 23 1 0
24 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
33 34 3 0
31 33 1 0
32 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
40 43 1 0
43 44 1 0
43 45 2 0
44 46 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 652.79Molecular Weight (Monoisotopic): 652.2920AlogP: 5.56#Rotatable Bonds: 9Polar Surface Area: 93.32Molecular Species: BASEHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.76CX LogP: 4.80CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.25Np Likeness Score: -1.72
References 1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J.. (2018) Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction., 61 (11): [PMID:29738674 ] [10.1021/acs.jmedchem.8b00071 ]