N-(2-(diethylamino)ethyl)-3-(6-phenylimidazo[1,2-b]pyridazin-3-yl)benzamide

ID: ALA4210073

PubChem CID: 145966371

Max Phase: Preclinical

Molecular Formula: C25H27N5O

Molecular Weight: 413.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(CC)CCNC(=O)c1cccc(-c2cnc3ccc(-c4ccccc4)nn23)c1

Standard InChI:  InChI=1S/C25H27N5O/c1-3-29(4-2)16-15-26-25(31)21-12-8-11-20(17-21)23-18-27-24-14-13-22(28-30(23)24)19-9-6-5-7-10-19/h5-14,17-18H,3-4,15-16H2,1-2H3,(H,26,31)

Standard InChI Key:  NRYVXBBPOQJNAW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   19.7116  -16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7116  -17.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4169  -17.7512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4169  -16.1168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1222  -16.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1267  -17.3432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9017  -17.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3766  -16.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8947  -16.2739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9005  -18.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1908  -18.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1897  -19.6314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8976  -20.0414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6080  -19.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6056  -18.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4814  -20.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7743  -19.6294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4803  -20.8561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0660  -20.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3589  -19.6274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6506  -20.0350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9435  -19.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6494  -20.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0055  -17.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2969  -17.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5903  -17.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5910  -18.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3043  -18.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0080  -18.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2352  -20.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9412  -21.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  7 10  1  0
 12 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  2 24  1  0
 22 30  1  0
 23 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4210073

    ---

Associated Targets(Human)

CAMK2D Tchem CaM kinase II delta (2813 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 413.53Molecular Weight (Monoisotopic): 413.2216AlogP: 4.13#Rotatable Bonds: 8
Polar Surface Area: 62.53Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.04CX LogP: 4.06CX LogD: 2.41
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.84

References

1. Koltun DO, Parkhill EQ, Kalla R, Perry TD, Elzein E, Li X, Simonovich SP, Ziebenhaus C, Hansen TR, Marchand B, Hung WK, Lagpacan L, Hung M, Aoyama RG, Murray BP, Perry JK, Somoza JR, Villaseñor AG, Pagratis N, Zablocki JA..  (2018)  Discovery of potent and selective inhibitors of calmodulin-dependent kinase II (CaMKII).,  28  (3): [PMID:29254643] [10.1016/j.bmcl.2017.10.040]

Source