The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((2,5-dioxo-3-(pyridin-3-ylmethyl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-4(5H)-yl)methyl)benzoic acid ID: ALA4210191
PubChem CID: 145963833
Max Phase: Preclinical
Molecular Formula: C23H19N3O4
Molecular Weight: 401.42
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(CN2C(=O)c3ccccc3NC(=O)[C@H]2Cc2cccnc2)cc1
Standard InChI: InChI=1S/C23H19N3O4/c27-21-20(12-16-4-3-11-24-13-16)26(14-15-7-9-17(10-8-15)23(29)30)22(28)18-5-1-2-6-19(18)25-21/h1-11,13,20H,12,14H2,(H,25,27)(H,29,30)/t20-/m1/s1
Standard InChI Key: JHONTRULXQQRSP-HXUWFJFHSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
5.1262 -5.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1262 -6.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8407 -7.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8407 -5.5626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5551 -6.8001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5551 -5.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2002 -5.4607 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2002 -7.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0045 -5.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0045 -7.1309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3624 -6.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5189 -4.9993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0166 -8.1188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1874 -6.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5999 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5189 -7.7759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2174 -8.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7318 -9.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4304 -9.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6146 -10.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1003 -9.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4017 -8.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3132 -10.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4974 -10.9708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8276 -11.4928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4249 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8374 -7.8166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4249 -8.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5999 -8.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1874 -7.8166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 11 1 0
9 12 2 0
8 13 2 0
11 14 1 1
14 15 1 0
10 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
15 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 15 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 401.42Molecular Weight (Monoisotopic): 401.1376AlogP: 2.99#Rotatable Bonds: 5Polar Surface Area: 99.60Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.01CX Basic pKa: 4.98CX LogP: 2.37CX LogD: 0.23Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.68Np Likeness Score: -0.41
References 1. Letourneau JJ, Stroke IL, Hilbert DW, Sturzenbecker LJ, Marinelli BA, Quintero JG, Sabalski J, Ma L, Diller DJ, Stein PD, Webb ML.. (2018) Identification and initial optimization of inhibitors of Clostridium difficile (C. difficile) toxin B (TcdB)., 28 (4): [PMID:29331267 ] [10.1016/j.bmcl.2018.01.005 ]