The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((8-chloro-2,5-dioxo-3-(pyridin-3-ylmethyl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-4(5H)-yl)methyl)-N-(pyrimidin-2-yl)benzamide ID: ALA4210388
PubChem CID: 132214230
Max Phase: Preclinical
Molecular Formula: C27H21ClN6O3
Molecular Weight: 512.96
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ncccn1)c1ccc(CN2C(=O)c3ccc(Cl)cc3NC(=O)[C@H]2Cc2cccnc2)cc1
Standard InChI: InChI=1S/C27H21ClN6O3/c28-20-8-9-21-22(14-20)32-25(36)23(13-18-3-1-10-29-15-18)34(26(21)37)16-17-4-6-19(7-5-17)24(35)33-27-30-11-2-12-31-27/h1-12,14-15,23H,13,16H2,(H,32,36)(H,30,31,33,35)/t23-/m1/s1
Standard InChI Key: CVQAFQHAQPACLD-HSZRJFAPSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
11.1073 -11.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9058 -10.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2608 -10.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8318 -9.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8930 -9.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1360 -13.2322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8318 -10.0754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3055 -10.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5430 -11.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9058 -8.7360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9231 -11.8192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1305 -11.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1173 -8.8379 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.3055 -11.8063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0680 -9.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4374 -12.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2245 -8.2746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8930 -11.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7101 -8.9196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2608 -9.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5463 -8.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7101 -10.4062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1305 -10.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3202 -13.3551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2245 -11.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7222 -11.3941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5463 -10.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8059 -12.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0216 -14.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2136 -14.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5360 -14.7608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3518 -14.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8597 -15.2774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6670 -15.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9664 -14.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4522 -13.7541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6467 -13.8787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7 27 1 0
9 23 2 0
19 17 2 0
11 16 2 0
2 22 1 0
3 2 1 0
14 12 2 0
5 8 1 0
4 7 2 0
23 8 1 0
10 19 1 0
15 5 1 1
12 9 1 0
2 26 2 0
28 1 2 0
20 21 2 0
4 13 1 0
20 10 1 0
3 20 1 0
22 25 1 0
6 24 2 0
18 14 1 0
8 18 2 0
16 6 1 0
22 15 1 0
19 15 1 0
21 4 1 0
24 28 1 0
1 11 1 0
27 3 2 0
25 11 1 0
24 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.96Molecular Weight (Monoisotopic): 512.1364AlogP: 3.98#Rotatable Bonds: 6Polar Surface Area: 117.18Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.23CX Basic pKa: 4.92CX LogP: 4.04CX LogD: 4.04Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -1.06
References 1. Letourneau JJ, Stroke IL, Hilbert DW, Sturzenbecker LJ, Marinelli BA, Quintero JG, Sabalski J, Ma L, Diller DJ, Stein PD, Webb ML.. (2018) Identification and initial optimization of inhibitors of Clostridium difficile (C. difficile) toxin B (TcdB)., 28 (4): [PMID:29331267 ] [10.1016/j.bmcl.2018.01.005 ]