5-Fluoro-4-(5-fluoro-1,1-dimethyl-2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)-N-(5-((4-(2-fluoroethyl)piperazin-1-yl)methyl)pyridin-2-yl)pyrimidin-2-amine

ID: ALA4210707

PubChem CID: 129102574

Max Phase: Preclinical

Molecular Formula: C28H31F3N8

Molecular Weight: 536.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CCc2nc3c(F)cc(-c4nc(Nc5ccc(CN6CCN(CCF)CC6)cn5)ncc4F)cc3n21

Standard InChI:  InChI=1S/C28H31F3N8/c1-28(2)6-5-24-35-26-20(30)13-19(14-22(26)39(24)28)25-21(31)16-33-27(36-25)34-23-4-3-18(15-32-23)17-38-11-9-37(8-7-29)10-12-38/h3-4,13-16H,5-12,17H2,1-2H3,(H,32,33,34,36)

Standard InChI Key:  PYAFOBDKPDBAIO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   16.4217  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1361  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8506  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8506  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1361  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4217  -14.1363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7072  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.9927  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9927  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2783  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5638  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5638  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2783  -12.8988    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8493  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1349  -14.1363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4204  -14.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7059  -14.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7059  -13.3113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4204  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1349  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9914  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2770  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5625  -12.8988    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.2716  -10.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6071  -11.5218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9940  -12.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2796  -11.6613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4511  -10.8544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4431   -9.9611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7286   -9.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1155  -10.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5651  -12.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5651  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2796  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9940  -12.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4011  -10.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6306   -9.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7085  -13.3113    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.5651  -14.5488    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
  8 13  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 20  1  0
 21 22  1  0
 22 23  1  0
 18 21  1  0
 14 15  1  0
 11 14  1  0
  7  8  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 24 28  1  0
 29 30  1  0
 30 31  1  0
 28 31  1  0
 24 29  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 26 35  2  0
 27 32  2  0
 31 36  1  0
 31 37  1  0
 35 38  1  0
  3 33  1  0
  4 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4210707

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4 (2749 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK1 Tchem Cyclin-dependent kinase 1/ G1/S-specific cyclin-D3 (24 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK6 Tclin Cyclin-dependent kinase 6 (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 536.61Molecular Weight (Monoisotopic): 536.2624AlogP: 4.68#Rotatable Bonds: 7
Polar Surface Area: 75.00Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.27CX Basic pKa: 6.73CX LogP: 4.41CX LogD: 4.33
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.37Np Likeness Score: -1.14

References

1. Wang Y, Liu WJ, Yin L, Li H, Chen ZH, Zhu DX, Song XQ, Cheng ZZ, Song P, Wang Z, Li ZG..  (2018)  Design and synthesis of 4-(2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)-N-(5-(piperazin-1-ylmethyl)pyridine-2-yl)pyrimidin-2-amine as a highly potent and selective cyclin-dependent kinases 4 and 6 inhibitors and the discovery of structure-activity relationships.,  28  (5): [PMID:29429832] [10.1016/j.bmcl.2017.12.068]

Source