1-(4-methylphenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine

ID: ALA4210817

PubChem CID: 145967136

Max Phase: Preclinical

Molecular Formula: C23H30N2O4

Molecular Weight: 398.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)Cc1ccc(OCC(O)CN2CCN(c3ccc(C)cc3)CC2)cc1

Standard InChI:  InChI=1S/C23H30N2O4/c1-18-3-7-20(8-4-18)25-13-11-24(12-14-25)16-21(26)17-29-22-9-5-19(6-10-22)15-23(27)28-2/h3-10,21,26H,11-17H2,1-2H3

Standard InChI Key:  DMFWXZVPQGEGSB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    1.9136  -15.3821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125  -16.2017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6205  -16.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3302  -16.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3273  -15.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6187  -14.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6163  -14.1561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3228  -13.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0317  -14.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7382  -13.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0341  -14.9691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4471  -14.1476    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4440  -14.9618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1488  -15.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8577  -14.9610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8573  -14.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1479  -13.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5638  -15.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5618  -16.1881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2684  -16.5971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9774  -16.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9754  -15.3676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2683  -14.9622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6203  -17.4278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125  -17.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9123  -18.6534    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2049  -17.4275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4971  -17.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6853  -16.5973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 15 18  1  0
  3 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 21 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4210817

    ---

Associated Targets(non-human)

Thoracic aorta (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.50Molecular Weight (Monoisotopic): 398.2206AlogP: 2.27#Rotatable Bonds: 8
Polar Surface Area: 62.24Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.58CX LogP: 3.24CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.69Np Likeness Score: -1.12

References

1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M..  (2018)  Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes.,  28  (4): [PMID:29422390] [10.1016/j.bmcl.2018.01.068]

Source