The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 6-(3-(3-chloro-4-fluorophenyl)ureido)-4-oxo-1,4-dihydroquinoline-2-carboxylate ID: ALA4210902
PubChem CID: 145966891
Max Phase: Preclinical
Molecular Formula: C18H13ClFN3O4
Molecular Weight: 389.77
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(=O)c2cc(NC(=O)Nc3ccc(F)c(Cl)c3)ccc2[nH]1
Standard InChI: InChI=1S/C18H13ClFN3O4/c1-27-17(25)15-8-16(24)11-6-9(3-5-14(11)23-15)21-18(26)22-10-2-4-13(20)12(19)7-10/h2-8H,1H3,(H,23,24)(H2,21,22,26)
Standard InChI Key: GOTNKJRBXFDDQH-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
18.2863 -21.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2852 -22.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9932 -22.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9914 -21.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7001 -21.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7034 -22.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4119 -22.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1215 -22.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1181 -21.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4051 -21.0301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4141 -23.4886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8246 -21.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8221 -20.2118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5336 -21.4354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5361 -22.2526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5772 -22.6767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8698 -22.2676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1617 -22.6756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8704 -21.4504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4544 -22.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4598 -21.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7532 -21.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0442 -21.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0462 -22.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7533 -22.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3363 -21.0391 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.7543 -20.2220 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
22 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.77Molecular Weight (Monoisotopic): 389.0579AlogP: 3.75#Rotatable Bonds: 3Polar Surface Area: 100.29Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.72CX Basic pKa: ┄CX LogP: 3.85CX LogD: 3.85Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.59Np Likeness Score: -1.45
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]