The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-5-(2-(5-cyano-2-(2-hydroxy-2-methylpropoxy)phenylamino)pyrimidin-4-yl)-3-(hydroxymethyl)-3-methylindoline-7-carbonitrile ID: ALA4211057
PubChem CID: 130270771
Max Phase: Preclinical
Molecular Formula: C26H26N6O3
Molecular Weight: 470.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)COc1ccc(C#N)cc1Nc1nccc(-c2cc(C#N)c3c(c2)[C@@](C)(CO)CN3)n1
Standard InChI: InChI=1S/C26H26N6O3/c1-25(2,34)15-35-22-5-4-16(11-27)8-21(22)32-24-29-7-6-20(31-24)17-9-18(12-28)23-19(10-17)26(3,14-33)13-30-23/h4-10,30,33-34H,13-15H2,1-3H3,(H,29,31,32)/t26-/m1/s1
Standard InChI Key: JMYGNLMTXZTKNC-AREMUKBSSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
5.2044 -12.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4987 -12.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2090 -12.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4749 -13.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4738 -13.9028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1818 -14.3118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -13.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1835 -15.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4741 -15.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4735 -16.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1817 -16.7606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8918 -16.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8889 -15.5327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1800 -12.6744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8921 -13.0810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1618 -11.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3468 -11.8716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7671 -12.6749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0566 -12.2661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1999 -11.2962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6009 -16.7541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3072 -16.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0130 -16.7503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7189 -16.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7166 -15.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0026 -15.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2997 -15.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9971 -14.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9927 -13.4795 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0143 -17.5675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7227 -17.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4298 -17.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1381 -17.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4284 -16.7480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1348 -17.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
14 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 8 1 0
14 15 2 0
15 2 1 0
2 16 1 0
16 17 1 0
17 14 1 0
4 18 1 0
18 19 3 0
1 20 1 0
12 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
28 29 3 0
23 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.53Molecular Weight (Monoisotopic): 470.2066AlogP: 3.46#Rotatable Bonds: 7Polar Surface Area: 147.11Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: 2.09CX LogP: 2.74CX LogD: 2.74Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -0.59
References 1. Kargbo RB.. (2017) New Substituted Cyanoindoline Derivatives as MAP3K14 Kinase Inhibitors for the Treatment of Cancer and Autoimmune Disorders., 8 (9): [PMID:28947934 ] [10.1021/acsmedchemlett.7b00330 ]