3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1-(5-morpholinopyridin-3-yl)indolin-2-one

ID: ALA4211194

PubChem CID: 129104140

Max Phase: Preclinical

Molecular Formula: C24H25N5O2

Molecular Weight: 415.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2ccc3c(c2)N(c2cncc(N4CCOCC4)c2)C(=O)C3(C)C)cn1

Standard InChI:  InChI=1S/C24H25N5O2/c1-16-26-12-18(13-27-16)17-4-5-21-22(10-17)29(23(30)24(21,2)3)20-11-19(14-25-15-20)28-6-8-31-9-7-28/h4-5,10-15H,6-9H2,1-3H3

Standard InChI Key:  UNVGTXOAVBOYGO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   27.3965  -16.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4007  -17.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1063  -17.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2077  -17.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2066  -18.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9146  -18.9343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9128  -17.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5004  -18.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7927  -18.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0852  -18.9301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0841  -19.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7965  -20.1572    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.5011  -19.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6214  -17.7022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6263  -18.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4106  -18.7752    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8906  -18.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7078  -18.1011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.3955  -19.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6788  -19.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6635  -20.8037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.3641  -21.2260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0816  -20.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0934  -20.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7797  -21.2446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.7655  -22.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4630  -22.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1791  -22.0870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.1932  -21.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4913  -20.8455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3766  -20.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 15  2  0
 14  7  2  0
  7  4  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17  2  1  0
  2 14  1  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 16 19  1  0
 25 26  1  0
 25 30  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 23 25  1  0
 11 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4211194

    ---

Associated Targets(non-human)

Slc29a1 Equilibrative nucleoside transporter 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.50Molecular Weight (Monoisotopic): 415.2008AlogP: 3.64#Rotatable Bonds: 3
Polar Surface Area: 71.45Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.62CX LogP: 2.67CX LogD: 2.67
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -0.82

References

1. Rosse G..  (2017)  Indolinone Inhibitors of ENT1 for the Treatment of Schizophrenia.,  (10): [PMID:29057039] [10.1021/acsmedchemlett.7b00378]

Source