1-(2-(4-(2-Fluoroacetyl)piperazin-1-yl)ethyl)-4-methyl-5-((4-((6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl)amino)piperidin-1-yl)methyl)-1H-indole-2-carbonitrile

ID: ALA4211318

PubChem CID: 130375983

Max Phase: Preclinical

Molecular Formula: C32H36F4N8OS

Molecular Weight: 656.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCN1CCN(C(=O)CF)CC1

Standard InChI:  InChI=1S/C32H36F4N8OS/c1-21-22(2-3-28-26(21)14-24(18-37)44(28)13-10-41-8-11-43(12-9-41)29(45)17-33)19-42-6-4-23(5-7-42)40-30-27-15-25(16-32(34,35)36)46-31(27)39-20-38-30/h2-3,14-15,20,23H,4-13,16-17,19H2,1H3,(H,38,39,40)

Standard InChI Key:  LEXHBKLOMBAPDX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 46 51  0  0  0  0  0  0  0  0999 V2000
   28.9759  -18.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9747  -19.2765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6869  -19.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6851  -18.0398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3896  -18.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3903  -19.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1827  -19.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6642  -18.8511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1749  -18.1876    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   32.4855  -18.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8940  -18.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7153  -18.1273    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.4771  -17.4227    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.2944  -17.4169    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   29.6879  -20.5067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3920  -20.9186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3917  -21.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1000  -22.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8137  -21.7405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8146  -20.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1018  -20.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5245  -22.1508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2374  -21.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9458  -22.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9449  -20.5144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2354  -20.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9418  -22.9784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6607  -20.9287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6586  -21.7489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4382  -22.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9195  -21.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4415  -20.6745    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7406  -21.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5619  -21.3394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4364  -19.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1457  -19.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1406  -18.6177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.8453  -18.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8421  -17.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1337  -16.9805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.4226  -17.3923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4241  -18.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1317  -16.1592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8384  -15.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4188  -15.7482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.5512  -16.1557    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
 11 14  1  0
  3 15  1  0
 15 16  1  0
 16 17  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  2  0
 24 29  1  0
 28 25  1  0
 25 26  2  0
 26 23  1  0
 24 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  1  0
 33 34  3  0
 31 33  1  0
 32 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 37 42  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 40 43  1  0
 43 44  1  0
 43 45  2  0
 44 46  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4211318

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Men1 Menin (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 656.75Molecular Weight (Monoisotopic): 656.2669AlogP: 5.12#Rotatable Bonds: 9
Polar Surface Area: 93.32Molecular Species: BASEHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.75CX LogP: 4.17CX LogD: 2.72
Aromatic Rings: 4Heavy Atoms: 46QED Weighted: 0.25Np Likeness Score: -1.66

References

1. Borkin D, Klossowski S, Pollock J, Miao H, Linhares BM, Kempinska K, Jin Z, Purohit T, Wen B, He M, Sun D, Cierpicki T, Grembecka J..  (2018)  Complexity of Blocking Bivalent Protein-Protein Interactions: Development of a Highly Potent Inhibitor of the Menin-Mixed-Lineage Leukemia Interaction.,  61  (11): [PMID:29738674] [10.1021/acs.jmedchem.8b00071]

Source