The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-((2-ethyl-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl)methyl)phenyl)propyl)-1-isopropylpiperidin-4-ol ID: ALA4211343
PubChem CID: 145966675
Max Phase: Preclinical
Molecular Formula: C28H40N4O
Molecular Weight: 448.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(C)cc(C)nc2c1Cc1ccc(CCCC2(O)CCN(C(C)C)CC2)cc1
Standard InChI: InChI=1S/C28H40N4O/c1-6-26-25(27-29-21(4)18-22(5)32(27)30-26)19-24-11-9-23(10-12-24)8-7-13-28(33)14-16-31(17-15-28)20(2)3/h9-12,18,20,33H,6-8,13-17,19H2,1-5H3
Standard InChI Key: LTOUJPZHCMXJQW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.4159 -11.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8570 -11.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6754 -11.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0508 -11.1597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7934 -10.5135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6048 -10.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8149 -9.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1331 -9.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5019 -9.7550 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0900 -8.4272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7752 -7.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5996 -11.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1174 -12.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2341 -9.6824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2330 -10.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9410 -10.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6507 -10.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6478 -9.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9392 -9.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5263 -9.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3590 -10.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0661 -10.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7744 -10.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4815 -10.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1865 -10.9089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8915 -10.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8944 -9.6851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1862 -9.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4751 -9.6834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6030 -9.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3098 -9.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6048 -8.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4742 -11.3127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
1 12 1 0
3 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
14 20 1 0
20 7 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
24 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.66Molecular Weight (Monoisotopic): 448.3202AlogP: 5.06#Rotatable Bonds: 8Polar Surface Area: 53.66Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.37CX LogP: 5.04CX LogD: 3.08Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -0.75
References 1. Velcicky J, Miltz W, Oberhauser B, Orain D, Vaupel A, Weigand K, Dawson King J, Littlewood-Evans A, Nash M, Feifel R, Loetscher P.. (2017) Development of Selective, Orally Active GPR4 Antagonists with Modulatory Effects on Nociception, Inflammation, and Angiogenesis., 60 (9): [PMID:28445047 ] [10.1021/acs.jmedchem.6b01703 ]