The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((8-chloro-2,5-dioxo-3-(pyridin-3-ylmethyl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-4(5H)-yl)methyl)-N-(thiazol-2-yl)benzamide ID: ALA4211420
PubChem CID: 132214435
Max Phase: Preclinical
Molecular Formula: C26H20ClN5O3S
Molecular Weight: 518.00
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1nccs1)c1ccc(CN2C(=O)c3ccc(Cl)cc3NC(=O)[C@H]2Cc2cccnc2)cc1
Standard InChI: InChI=1S/C26H20ClN5O3S/c27-19-7-8-20-21(13-19)30-24(34)22(12-17-2-1-9-28-14-17)32(25(20)35)15-16-3-5-18(6-4-16)23(33)31-26-29-10-11-36-26/h1-11,13-14,22H,12,15H2,(H,30,34)(H,29,31,33)/t22-/m1/s1
Standard InChI Key: SVGGKNVMJZDGAS-JOCHJYFZSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
18.2887 -26.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0872 -24.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4422 -24.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0132 -23.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0744 -24.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3174 -27.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0132 -24.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4869 -24.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7244 -25.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0872 -23.0985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1045 -26.1817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3119 -26.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2987 -23.2004 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.4869 -26.1688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2494 -24.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6188 -26.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4059 -22.6371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0744 -25.4544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8915 -23.2821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4422 -23.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7277 -23.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8915 -24.7687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3119 -24.7399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5016 -27.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4059 -25.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9036 -25.7566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.7277 -24.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9873 -27.0726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2030 -28.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3949 -28.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7125 -29.1172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5206 -28.9955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0931 -29.5741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.8240 -29.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7022 -28.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8961 -28.2666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7 27 1 0
9 23 2 0
19 17 2 0
11 16 2 0
2 22 1 0
3 2 1 0
14 12 2 0
5 8 1 0
4 7 2 0
23 8 1 0
10 19 1 0
15 5 1 1
12 9 1 0
2 26 2 0
28 1 2 0
20 21 2 0
4 13 1 0
20 10 1 0
3 20 1 0
22 25 1 0
6 24 2 0
18 14 1 0
8 18 2 0
16 6 1 0
22 15 1 0
19 15 1 0
21 4 1 0
24 28 1 0
1 11 1 0
27 3 2 0
25 11 1 0
24 29 1 0
29 30 2 0
29 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.00Molecular Weight (Monoisotopic): 517.0975AlogP: 4.65#Rotatable Bonds: 6Polar Surface Area: 104.29Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.58CX Basic pKa: 4.92CX LogP: 4.63CX LogD: 4.63Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: -1.31
References 1. Letourneau JJ, Stroke IL, Hilbert DW, Sturzenbecker LJ, Marinelli BA, Quintero JG, Sabalski J, Ma L, Diller DJ, Stein PD, Webb ML.. (2018) Identification and initial optimization of inhibitors of Clostridium difficile (C. difficile) toxin B (TcdB)., 28 (4): [PMID:29331267 ] [10.1016/j.bmcl.2018.01.005 ]