The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{4-(2-([1,1'-Biphenyl]-4-yl)-4-methylthiazol-5-yl)-pyrimidin-2-yl}morpholine-4-carboximidamide ID: ALA4212292
PubChem CID: 145965765
Max Phase: Preclinical
Molecular Formula: C25H24N6OS
Molecular Weight: 456.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nc(-c2ccc(-c3ccccc3)cc2)sc1-c1ccnc(NC(=N)N2CCOCC2)n1
Standard InChI: InChI=1S/C25H24N6OS/c1-17-22(21-11-12-27-25(29-21)30-24(26)31-13-15-32-16-14-31)33-23(28-17)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h2-12H,13-16H2,1H3,(H2,26,27,29,30)
Standard InChI Key: TXYMXMGOEICJCD-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
15.7721 -4.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9516 -4.0686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6159 -3.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1007 -2.6475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9212 -2.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2569 -3.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1078 -4.9083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9283 -4.9943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6230 -5.5758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8025 -5.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3177 -6.1573 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4972 -6.0712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1615 -5.3176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6463 -4.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4668 -4.7361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2676 -7.5233 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.6002 -8.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9327 -7.5236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1875 -6.7389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0125 -6.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7024 -6.0716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6007 -10.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8862 -10.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8860 -9.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6004 -8.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3149 -9.2457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3151 -10.0707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6009 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3155 -11.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3156 -12.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6012 -12.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8867 -12.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8865 -11.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
7 9 1 0
1 7 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
10 15 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
16 20 1 0
19 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
22 28 1 0
17 25 1 0
12 20 1 0
9 10 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.58Molecular Weight (Monoisotopic): 456.1732AlogP: 4.92#Rotatable Bonds: 4Polar Surface Area: 87.02Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.07CX LogP: 4.52CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.37
References 1. Hagras M, Mohammad H, Mandour MS, Hegazy YA, Ghiaty A, Seleem MN, Mayhoub AS.. (2017) Investigating the Antibacterial Activity of Biphenylthiazoles against Methicillin- and Vancomycin-Resistant Staphylococcus aureus (MRSA and VRSA)., 60 (9): [PMID:28436655 ] [10.1021/acs.jmedchem.7b00392 ]