The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 4-oxo-6-(3-(3,4,5-trimethoxyphenyl)ureido)-1,4-dihydroquinoline-2-carboxylate ID: ALA4212347
PubChem CID: 145964394
Max Phase: Preclinical
Molecular Formula: C21H21N3O7
Molecular Weight: 427.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc(=O)c2cc(NC(=O)Nc3cc(OC)c(OC)c(OC)c3)ccc2[nH]1
Standard InChI: InChI=1S/C21H21N3O7/c1-28-17-8-12(9-18(29-2)19(17)30-3)23-21(27)22-11-5-6-14-13(7-11)16(25)10-15(24-14)20(26)31-4/h5-10H,1-4H3,(H,24,25)(H2,22,23,27)
Standard InChI Key: WWADLQMKEDCALH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
15.8100 -2.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8088 -3.2174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5169 -3.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5151 -1.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2237 -2.3943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2271 -3.2149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9355 -3.6201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6452 -3.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6418 -2.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9288 -1.9788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9378 -4.4373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3483 -1.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3457 -1.1605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0572 -2.3841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0597 -3.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1008 -3.6255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3934 -3.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3941 -2.3991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6854 -3.6243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6848 -4.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9755 -4.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9745 -5.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6825 -6.0748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3928 -5.6624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3903 -4.8473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1017 -6.0690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6829 -6.8920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2663 -6.0725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5591 -5.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9754 -7.3010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1039 -6.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
9 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 26 1 0
23 27 1 0
22 28 1 0
28 29 1 0
27 30 1 0
26 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.41Molecular Weight (Monoisotopic): 427.1380AlogP: 2.98#Rotatable Bonds: 6Polar Surface Area: 127.98Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.71CX Basic pKa: ┄CX LogP: 2.63CX LogD: 2.63Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.52Np Likeness Score: -0.75
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]