The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((trans-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)amino)propanoic acid ID: ALA4212500
Max Phase: Preclinical
Molecular Formula: C27H29N5O3
Molecular Weight: 471.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N[C@H]1CC[C@H](n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1)C(=O)O
Standard InChI: InChI=1S/C27H29N5O3/c1-17(27(33)34)31-19-9-11-20(12-10-19)32-15-23(24-25(28)29-16-30-26(24)32)18-7-13-22(14-8-18)35-21-5-3-2-4-6-21/h2-8,13-17,19-20,31H,9-12H2,1H3,(H,33,34)(H2,28,29,30)/t17-,19-,20-/m1/s1
Standard InChI Key: POLFXOSYBGYACO-MISYRCLQSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
10.0491 -9.7520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0480 -10.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7589 -10.9899 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7571 -9.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4729 -9.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4777 -10.5747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2651 -10.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7486 -10.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2574 -9.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5106 -8.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3181 -8.5291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5673 -7.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0101 -7.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2008 -7.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9554 -8.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2582 -6.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0637 -6.1694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6175 -6.7812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4224 -6.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6711 -5.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1127 -5.2068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3100 -5.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7547 -8.5126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5274 -11.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9753 -12.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2305 -13.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0378 -13.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5896 -12.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3341 -11.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2931 -13.9502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0963 -14.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6439 -13.5078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4470 -13.6765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3885 -12.7280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3516 -14.8987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
4 23 1 0
24 7 1 1
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 6
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
31 35 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.56Molecular Weight (Monoisotopic): 471.2270AlogP: 5.02#Rotatable Bonds: 7Polar Surface Area: 115.29Molecular Species: ZWITTERIONHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.19CX Basic pKa: 10.83CX LogP: 1.95CX LogD: 1.77Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -0.41
References 1. Koda Y, Kikuzato K, Mikuni J, Tanaka A, Yuki H, Honma T, Tomabechi Y, Kukimoto-Niino M, Shirouzu M, Shirai F, Koyama H.. (2017) Identification of pyrrolo[2,3-d]pyrimidines as potent HCK and FLT3-ITD dual inhibitors., 27 (22): [PMID:29037944 ] [10.1016/j.bmcl.2017.10.012 ]