3-(6-(3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-2-oxoindolin-1-yl)pyrazin-2-yl)oxazolidin-2-one

ID: ALA4212967

PubChem CID: 129126903

Max Phase: Preclinical

Molecular Formula: C22H20N6O3

Molecular Weight: 416.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2ccc3c(c2)N(c2cncc(N4CCOC4=O)n2)C(=O)C3(C)C)cn1

Standard InChI:  InChI=1S/C22H20N6O3/c1-13-24-9-15(10-25-13)14-4-5-16-17(8-14)28(20(29)22(16,2)3)19-12-23-11-18(26-19)27-6-7-31-21(27)30/h4-5,8-12H,6-7H2,1-3H3

Standard InChI Key:  LWVHHVOPXGLKST-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   15.7041   -9.0428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7082   -9.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4139   -9.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5153  -10.1241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5141  -10.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2222  -11.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2204   -9.7152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8080  -11.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1003  -10.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3928  -11.3484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3917  -12.1665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1040  -12.5755    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8087  -12.1657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9290  -10.1205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9338  -10.9436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7182  -11.1934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1982  -10.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0154  -10.5194    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7031  -12.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9864  -12.4057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9710  -13.2220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6716  -13.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3891  -13.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4010  -12.4294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.0872  -13.6629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6842  -12.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1609  -14.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9541  -14.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3726  -13.9571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8379  -13.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0209  -12.5470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 15  2  0
 14  7  2  0
  7  4  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17  2  1  0
  2 14  1  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 16 19  1  0
 23 25  1  0
 11 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 25  1  0
 30 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4212967

    ---

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Slc29a1 Equilibrative nucleoside transporter 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.44Molecular Weight (Monoisotopic): 416.1597AlogP: 3.15#Rotatable Bonds: 3
Polar Surface Area: 101.41Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.22CX LogP: 2.39CX LogD: 2.39
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.65Np Likeness Score: -0.93

References

1. Rosse G..  (2017)  Indolinone Inhibitors of ENT1 for the Treatment of Schizophrenia.,  (10): [PMID:29057039] [10.1021/acsmedchemlett.7b00378]

Source