The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-(7-chloroquinolin-4-yl)-N4-(4-(5-fluorobenzo[b]thiophen-3-yl)benzyl)butane-1,4-diamine ID: ALA4213343
PubChem CID: 145964199
Max Phase: Preclinical
Molecular Formula: C28H25ClFN3S
Molecular Weight: 490.05
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc2scc(-c3ccc(CNCCCCNc4ccnc5cc(Cl)ccc45)cc3)c2c1
Standard InChI: InChI=1S/C28H25ClFN3S/c29-21-7-9-23-26(11-14-33-27(23)15-21)32-13-2-1-12-31-17-19-3-5-20(6-4-19)25-18-34-28-10-8-22(30)16-24(25)28/h3-11,14-16,18,31H,1-2,12-13,17H2,(H,32,33)
Standard InChI Key: SAMYUJPXDPOOOM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
29.8313 -24.0149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5451 -23.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5423 -22.7787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8295 -22.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1192 -23.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1214 -22.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4114 -22.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6986 -22.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7002 -23.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4109 -24.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8260 -21.5480 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.5361 -21.1363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2456 -21.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9557 -21.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9894 -24.0178 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.6692 -21.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3793 -21.1242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0929 -21.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8030 -21.1182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5122 -21.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2218 -21.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2187 -20.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5002 -19.8843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7935 -20.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9241 -19.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6748 -20.2082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2223 -19.5937 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.0073 -19.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8066 -18.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0546 -18.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5043 -17.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7028 -17.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4585 -18.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1473 -17.0767 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
4 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
9 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 2 0
26 27 1 0
27 29 1 0
28 25 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.05Molecular Weight (Monoisotopic): 489.1442AlogP: 7.89#Rotatable Bonds: 9Polar Surface Area: 36.95Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.56CX LogP: 6.81CX LogD: 4.44Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.21Np Likeness Score: -1.51
References 1. Konstantinović J, Videnović M, Orsini S, Bogojević K, D'Alessandro S, Scaccabarozzi D, Terzić Jovanović N, Gradoni L, Basilico N, Šolaja BA.. (2018) Novel Aminoquinoline Derivatives Significantly Reduce Parasite Load in Leishmania infantum Infected Mice., 9 (7): [PMID:30034591 ] [10.1021/acsmedchemlett.8b00053 ]