7-(cis-4-(isopentylamino)cyclohexyl)-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine

ID: ALA4213372

Max Phase: Preclinical

Molecular Formula: C29H35N5O

Molecular Weight: 469.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CCN[C@H]1CC[C@@H](n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)ncnc32)CC1

Standard InChI:  InChI=1S/C29H35N5O/c1-20(2)16-17-31-22-10-12-23(13-11-22)34-18-26(27-28(30)32-19-33-29(27)34)21-8-14-25(15-9-21)35-24-6-4-3-5-7-24/h3-9,14-15,18-20,22-23,31H,10-13,16-17H2,1-2H3,(H2,30,32,33)/t22-,23+

Standard InChI Key:  DEFQAMZNXBZPPX-ZRZAMGCNSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   10.0533   -9.7562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0522  -10.5837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7635  -10.9946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7617   -9.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4778   -9.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4826  -10.5791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2703  -10.8287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7540  -10.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2626   -9.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5159   -8.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3238   -8.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5730   -7.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0156   -7.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2059   -7.3183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9605   -8.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2638   -6.3526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0697   -6.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6236   -6.7841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4289   -6.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6777   -5.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1191   -5.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3160   -5.3882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7593   -8.5162    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5327  -11.6122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9804  -12.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2357  -13.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0433  -13.1759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5953  -12.5590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3397  -11.7720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2988  -13.9561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1022  -14.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3577  -14.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1612  -15.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4167  -15.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7090  -14.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  4 23  1  0
 24  7  1  1
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  1
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4213372

    ---

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.63Molecular Weight (Monoisotopic): 469.2842AlogP: 6.59#Rotatable Bonds: 8
Polar Surface Area: 77.99Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.94CX LogP: 6.00CX LogD: 2.91
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -0.44

References

1. Koda Y, Kikuzato K, Mikuni J, Tanaka A, Yuki H, Honma T, Tomabechi Y, Kukimoto-Niino M, Shirouzu M, Shirai F, Koyama H..  (2017)  Identification of pyrrolo[2,3-d]pyrimidines as potent HCK and FLT3-ITD dual inhibitors.,  27  (22): [PMID:29037944] [10.1016/j.bmcl.2017.10.012]

Source