The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(2-(diethylamino)propyl)-2-(dimethylamino)-6-(5-(thiophen-2-yl)pyrazolo[1,5-a]pyrimidin-3-yl)isonicotinamide ID: ALA4213838
PubChem CID: 134539513
Max Phase: Preclinical
Molecular Formula: C25H31N7OS
Molecular Weight: 477.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)[C@@H](C)CNC(=O)c1cc(-c2cnn3ccc(-c4cccs4)nc23)nc(N(C)C)c1
Standard InChI: InChI=1S/C25H31N7OS/c1-6-31(7-2)17(3)15-26-25(33)18-13-21(28-23(14-18)30(4)5)19-16-27-32-11-10-20(29-24(19)32)22-9-8-12-34-22/h8-14,16-17H,6-7,15H2,1-5H3,(H,26,33)/t17-/m0/s1
Standard InChI Key: ARXMXGHDXSLZIO-KRWDZBQOSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
23.1455 -2.4474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1455 -3.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8508 -3.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8508 -2.0347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5561 -2.4474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5605 -3.2611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3355 -3.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8104 -2.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3285 -2.1918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3678 -3.5126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7112 -3.0261 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.0456 -3.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2908 -4.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1080 -4.2873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3344 -4.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6247 -4.7328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6236 -5.5493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3314 -5.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0419 -5.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0395 -4.7319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9153 -5.9569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2082 -5.5473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.9141 -6.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4999 -5.9549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7927 -5.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0845 -5.9529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3773 -5.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0833 -6.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6690 -5.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3750 -7.1776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7939 -4.7281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7506 -5.9538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4573 -5.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7528 -6.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 5 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 10 2 0
2 10 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
7 15 1 0
17 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
26 28 1 0
27 29 1 0
28 30 1 0
25 31 1 1
19 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.64Molecular Weight (Monoisotopic): 477.2311AlogP: 4.05#Rotatable Bonds: 9Polar Surface Area: 78.66Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.33CX LogP: 4.20CX LogD: 2.28Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -2.10
References 1. Koltun DO, Parkhill EQ, Kalla R, Perry TD, Elzein E, Li X, Simonovich SP, Ziebenhaus C, Hansen TR, Marchand B, Hung WK, Lagpacan L, Hung M, Aoyama RG, Murray BP, Perry JK, Somoza JR, Villaseñor AG, Pagratis N, Zablocki JA.. (2018) Discovery of potent and selective inhibitors of calmodulin-dependent kinase II (CaMKII)., 28 (3): [PMID:29254643 ] [10.1016/j.bmcl.2017.10.040 ]