The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(4-(cyclopropanecarbonyl)piperazine-1-carbonyl)-6-fluoroquinolin-4-yl)-4-phenylpiperidine-4-carbonitrile ID: ALA4213848
PubChem CID: 142581553
Max Phase: Preclinical
Molecular Formula: C30H30FN5O2
Molecular Weight: 511.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#CC1(c2ccccc2)CCN(c2c(C(=O)N3CCN(C(=O)C4CC4)CC3)cnc3ccc(F)cc23)CC1
Standard InChI: InChI=1S/C30H30FN5O2/c31-23-8-9-26-24(18-23)27(34-12-10-30(20-32,11-13-34)22-4-2-1-3-5-22)25(19-33-26)29(38)36-16-14-35(15-17-36)28(37)21-6-7-21/h1-5,8-9,18-19,21H,6-7,10-17H2
Standard InChI Key: FOUWVAHUAQGPHA-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
17.5696 -12.6087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9823 -13.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3908 -12.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2083 -16.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0255 -16.9794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6205 -16.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2793 -16.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2781 -16.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9862 -17.4072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9844 -15.7698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6930 -16.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6938 -16.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4023 -17.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1106 -16.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1058 -16.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3967 -15.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9820 -14.9526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8111 -15.7553 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.5715 -15.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5713 -14.9531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8639 -16.1790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1542 -15.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4487 -16.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4447 -16.9864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1523 -17.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8640 -16.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7355 -17.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7326 -18.2096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6926 -14.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6921 -13.7329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2767 -13.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2755 -14.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1589 -11.9022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2113 -12.6063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6197 -11.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2069 -11.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3815 -11.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9769 -11.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
4 6 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 17 1 0
15 18 1 0
7 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 5 1 0
27 28 2 0
17 29 1 0
17 32 1 0
29 30 1 0
30 2 1 0
2 31 1 0
31 32 1 0
1 33 3 0
3 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 3 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.60Molecular Weight (Monoisotopic): 511.2384AlogP: 4.13#Rotatable Bonds: 4Polar Surface Area: 80.54Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.88CX LogP: 3.35CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.53Np Likeness Score: -1.36
References 1. Yang SM, Martinez NJ, Yasgar A, Danchik C, Johansson C, Wang Y, Baljinnyam B, Wang AQ, Xu X, Shah P, Cheff D, Wang XS, Roth J, Lal-Nag M, Dunford JE, Oppermann U, Vasiliou V, Simeonov A, Jadhav A, Maloney DJ.. (2018) Discovery of Orally Bioavailable, Quinoline-Based Aldehyde Dehydrogenase 1A1 (ALDH1A1) Inhibitors with Potent Cellular Activity., 61 (11): [PMID:29767973 ] [10.1021/acs.jmedchem.8b00270 ]