The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-dimethoxy-2-(4-methoxyphenyl)-1-(4-nitrophenylsulfonyl)quinolin-4(1H)-one ID: ALA4214310
PubChem CID: 145972728
Max Phase: Preclinical
Molecular Formula: C24H20N2O8S
Molecular Weight: 496.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(=O)c3c(OC)cc(OC)cc3n2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1
Standard InChI: InChI=1S/C24H20N2O8S/c1-32-17-8-4-15(5-9-17)20-14-22(27)24-21(12-18(33-2)13-23(24)34-3)25(20)35(30,31)19-10-6-16(7-11-19)26(28)29/h4-14H,1-3H3
Standard InChI Key: UZSWNAABNAWYEC-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
13.3929 -2.6373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9884 -3.3472 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.8054 -3.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8780 -4.5853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8768 -5.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5849 -5.8138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5831 -4.1765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2917 -4.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2951 -5.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0035 -5.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7131 -5.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7098 -4.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9968 -4.1662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0057 -6.6247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4149 -4.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1242 -4.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8301 -4.1638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8281 -3.3457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1141 -2.9395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4111 -3.3520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5340 -2.9340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2435 -3.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1702 -4.1769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5854 -6.6310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8780 -7.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4625 -4.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2823 -2.9443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2803 -2.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5712 -1.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8648 -2.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8719 -2.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5816 -3.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1539 -1.7341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4490 -2.1475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1484 -0.9169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 15 1 0
18 21 1 0
21 22 1 0
4 23 1 0
6 24 1 0
24 25 1 0
23 26 1 0
13 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 2 0
33 35 1 0
30 33 1 0
M CHG 2 33 1 35 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.50Molecular Weight (Monoisotopic): 496.0940AlogP: 3.84#Rotatable Bonds: 7Polar Surface Area: 126.97Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -0.63
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]