N-[1-(3,4-Difluoro-benzyl)-1H-pyrazol-3-yl]-2-[6-(2,2,2-trifluoro-ethoxy)-pyridin-3-yl]-acetamide

ID: ALA4214341

PubChem CID: 126740598

Max Phase: Preclinical

Molecular Formula: C19H15F5N4O2

Molecular Weight: 426.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(OCC(F)(F)F)nc1)Nc1ccn(Cc2ccc(F)c(F)c2)n1

Standard InChI:  InChI=1S/C19H15F5N4O2/c20-14-3-1-13(7-15(14)21)10-28-6-5-16(27-28)26-17(29)8-12-2-4-18(25-9-12)30-11-19(22,23)24/h1-7,9H,8,10-11H2,(H,26,27,29)

Standard InChI Key:  JQAPPDSVWXLUJA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   10.6668  -12.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9622  -13.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2467  -12.8370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9882  -12.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1668  -12.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9125  -12.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5796  -13.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2052  -13.2489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4926  -12.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7815  -13.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0730  -12.8403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3637  -13.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6515  -12.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6495  -12.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3655  -11.6168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0748  -12.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4910  -12.0162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3767  -13.2310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0808  -12.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0715  -11.9936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3522  -11.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6510  -12.0122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7738  -11.5757    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.7931  -13.2142    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.9421  -11.6176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9426  -10.8004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2352  -10.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2357   -9.5741    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5272  -10.7994    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5229   -9.9796    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  7  6  2  0
  3  7  1  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  2  0
  1 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22  1  1  0
 20 23  1  0
 19 24  1  0
 14 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4214341

    ---

Associated Targets(Human)

CACNA1H Tclin Voltage-gated T-type calcium channel alpha-1H subunit (1913 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1I Tclin Voltage-gated T-type calcium channel alpha-1I subunit (425 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA1G Tclin Voltage-gated T-type calcium channel alpha-1G subunit (1361 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.35Molecular Weight (Monoisotopic): 426.1115AlogP: 3.73#Rotatable Bonds: 7
Polar Surface Area: 69.04Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.30CX Basic pKa: 2.57CX LogP: 4.25CX LogD: 4.25
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.59Np Likeness Score: -2.69

References

1. Bezençon O, Heidmann B, Siegrist R, Stamm S, Richard S, Pozzi D, Corminboeuf O, Roch C, Kessler M, Ertel EA, Reymond I, Pfeifer T, de Kanter R, Toeroek-Schafroth M, Moccia LG, Mawet J, Moon R, Rey M, Capeleto B, Fournier E..  (2017)  Discovery of a Potent, Selective T-type Calcium Channel Blocker as a Drug Candidate for the Treatment of Generalized Epilepsies.,  60  (23): [PMID:29116786] [10.1021/acs.jmedchem.7b01236]

Source