The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-(N-(1-(3-(4-fluorobenzylideneamino)-4-oxo-3,4-dihydroquinazolin-2-yl)ethyl)sulfamoyl)phenyl)acetamide ID: ALA4214406
PubChem CID: 145973878
Max Phase: Preclinical
Molecular Formula: C25H22FN5O4S
Molecular Weight: 507.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(S(=O)(=O)NC(C)c2nc3ccccc3c(=O)n2/N=C/c2ccc(F)cc2)cc1
Standard InChI: InChI=1S/C25H22FN5O4S/c1-16(30-36(34,35)21-13-11-20(12-14-21)28-17(2)32)24-29-23-6-4-3-5-22(23)25(33)31(24)27-15-18-7-9-19(26)10-8-18/h3-16,30H,1-2H3,(H,28,32)/b27-15+
Standard InChI Key: FXCIWVUVOSOKMT-JFLMPSFJSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
37.6468 -5.3960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2384 -6.1126 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.0633 -6.1080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.9453 -3.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9441 -4.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6589 -4.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6571 -3.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3725 -3.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3733 -4.4733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0886 -4.8843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8037 -4.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7989 -3.6394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.0830 -3.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0786 -2.4072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5108 -3.2226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2278 -3.6308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9398 -3.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6546 -3.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3660 -3.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3615 -2.3835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6394 -1.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9309 -2.3940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5198 -4.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5229 -5.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.2327 -4.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2423 -6.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5284 -7.3521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5312 -8.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2478 -8.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9631 -8.1671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9567 -7.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2521 -9.4119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5398 -9.8281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5441 -10.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8232 -9.4193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0728 -1.9657 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 8 1 0
13 14 2 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
23 24 1 0
23 25 1 0
24 2 1 0
2 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
20 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.55Molecular Weight (Monoisotopic): 507.1377AlogP: 3.42#Rotatable Bonds: 7Polar Surface Area: 122.52Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.19CX Basic pKa: 1.93CX LogP: 3.37CX LogD: 3.37Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.74
References 1. Patel TS, Bhatt JD, Vanparia SF, Patel UH, Dixit RB, Chudasama CJ, Patel BD, Dixit BC.. (2017) Ionic liquid mediated stereoselective synthesis of alanine linked hybrid quinazoline-4(3H)-one derivatives perturbing the malarial reductase activity in folate pathway., 25 (24): [PMID:29126742 ] [10.1016/j.bmc.2017.10.041 ]