The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3'-chloro-4'-((2-methoxyethoxy)methoxy)-5'-(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)biphenyl-4-carboxylic acid ID: ALA4214493
PubChem CID: 145973883
Max Phase: Preclinical
Molecular Formula: C31H35ClO5
Molecular Weight: 523.07
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCOc1c(Cl)cc(-c2ccc(C(=O)O)cc2)cc1-c1ccc2c(c1)C(C)(C)CCC2(C)C
Standard InChI: InChI=1S/C31H35ClO5/c1-30(2)12-13-31(3,4)26-17-22(10-11-25(26)30)24-16-23(20-6-8-21(9-7-20)29(33)34)18-27(32)28(24)37-19-36-15-14-35-5/h6-11,16-18H,12-15,19H2,1-5H3,(H,33,34)
Standard InChI Key: SLNCTKGASCOEAI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
3.6113 -15.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2069 -14.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7979 -15.4415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7941 -12.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2069 -13.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6153 -12.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5052 -13.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5052 -14.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9158 -13.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9142 -14.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6184 -14.7393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3247 -14.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3224 -13.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6176 -13.1103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0258 -13.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7351 -13.5097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4410 -13.0995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4388 -12.2815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7249 -11.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0219 -12.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1457 -13.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1466 -14.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8546 -14.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5622 -14.3186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5573 -13.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8488 -13.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3117 -11.8835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3069 -11.0663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5967 -10.6619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5919 -9.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8818 -9.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8769 -8.6232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1668 -8.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2739 -14.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2772 -15.5424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9800 -14.3137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7194 -11.0581 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 1 0
7 5 1 0
8 2 1 0
2 10 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 15 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
17 21 1 0
20 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
34 35 1 0
34 36 2 0
24 34 1 0
19 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.07Molecular Weight (Monoisotopic): 522.2173AlogP: 7.72#Rotatable Bonds: 9Polar Surface Area: 64.99Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.07CX Basic pKa: ┄CX LogP: 8.01CX LogD: 4.90Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: 0.10
References 1. Thoreau E, Arlabosse JM, Bouix-Peter C, Chambon S, Chantalat L, Daver S, Dumais L, Duvert G, Feret A, Ouvry G, Pascau J, Raffin C, Rodeville N, Soulet C, Tabet S, Talano S, Portal T.. (2018) Structure-based design of Trifarotene (CD5789), a potent and selective RARγ agonist for the treatment of acne., 28 (10): [PMID:29706423 ] [10.1016/j.bmcl.2018.04.036 ]