(5Z)-5-(4-Phenoxybenzylidene)-3-phenyl-2-thioxoimidazolidin-4-one

ID: ALA4214545

PubChem CID: 145972278

Max Phase: Preclinical

Molecular Formula: C22H16N2O2S

Molecular Weight: 372.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1/C(=C/c2ccc(Oc3ccccc3)cc2)NC(=S)N1c1ccccc1

Standard InChI:  InChI=1S/C22H16N2O2S/c25-21-20(23-22(27)24(21)17-7-3-1-4-8-17)15-16-11-13-19(14-12-16)26-18-9-5-2-6-10-18/h1-15H,(H,23,27)/b20-15-

Standard InChI Key:  KMXRFHLHTHUSSH-HKWRFOASSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   25.0729   -8.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8901   -8.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1444   -7.4902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4815   -7.0080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8227   -7.4902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4802   -6.1908    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   26.3696   -8.9286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9182   -7.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5247   -7.7867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3016   -7.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4732   -6.7360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8618   -6.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0872   -6.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5917   -8.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7791   -8.8409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4518   -8.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6400   -8.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1580   -8.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4935   -9.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3043   -9.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3453   -8.5801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8649   -9.2413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0520   -9.1513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5719   -9.8116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9042  -10.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7214  -10.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1980   -9.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  2  0
  2  7  2  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  3  8  1  0
  1 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4214545

    ---

Associated Targets(Human)

PSMB2 Tclin Proteasome Macropain subunit (1025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB1 Tclin Proteasome component C5 (935 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.45Molecular Weight (Monoisotopic): 372.0932AlogP: 4.74#Rotatable Bonds: 4
Polar Surface Area: 41.57Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.73CX Basic pKa: CX LogP: 4.95CX LogD: 4.95
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.53Np Likeness Score: -1.02

References

1. Maccari R, Ettari R, Adornato I, Naß A, Wolber G, Bitto A, Mannino F, Aliquò F, Bruno G, Nicolò F, Previti S, Grasso S, Zappalà M, Ottanà R..  (2018)  Identification of 2-thioxoimidazolidin-4-one derivatives as novel noncovalent proteasome and immunoproteasome inhibitors.,  28  (3): [PMID:29292224] [10.1016/j.bmcl.2017.12.053]

Source