N-(5-((4-ethylpiperazin-1-yl)methyl)pyridin-2-yl)-5-fluoro-4-(5-fluoro-2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)pyrimidin-2-amine

ID: ALA4214566

PubChem CID: 122657632

Max Phase: Preclinical

Molecular Formula: C26H28F2N8

Molecular Weight: 490.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1CCN(Cc2ccc(Nc3ncc(F)c(-c4cc(F)c5nc6n(c5c4)CCC6)n3)nc2)CC1

Standard InChI:  InChI=1S/C26H28F2N8/c1-2-34-8-10-35(11-9-34)16-17-5-6-22(29-14-17)31-26-30-15-20(28)24(33-26)18-12-19(27)25-21(13-18)36-7-3-4-23(36)32-25/h5-6,12-15H,2-4,7-11,16H2,1H3,(H,29,30,31,33)

Standard InChI Key:  MGENEBPUTRSHKN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   16.0215  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7359  -12.8411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4504  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4504  -14.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7359  -14.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0215  -14.0786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3070  -12.8411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.8714  -10.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2069  -11.4641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5938  -12.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8794  -11.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0509  -10.7966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0429   -9.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3284   -9.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7153  -10.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1649  -12.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1649  -12.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8794  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5938  -12.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3083  -13.2536    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.1649  -14.4911    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   14.5925  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5925  -14.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8781  -14.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1636  -14.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1636  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8781  -12.8411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4491  -14.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7346  -14.0786    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0202  -14.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3057  -14.0786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3057  -13.2536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.0202  -12.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7346  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5912  -12.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8768  -13.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  8 12  1  0
 13 14  1  0
 14 15  1  0
 12 15  1  0
  8 13  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 10 19  2  0
 11 16  2  0
 19 20  1  0
  3 17  1  0
  4 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 22 27  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 29 34  1  0
 35 36  1  0
 32 35  1  0
 28 29  1  0
 25 28  1  0
  7 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4214566

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4 (2749 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK1 Tchem Cyclin-dependent kinase 1/ G1/S-specific cyclin-D3 (24 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CDK6 Tclin Cyclin-dependent kinase 6 (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 490.56Molecular Weight (Monoisotopic): 490.2405AlogP: 3.99#Rotatable Bonds: 6
Polar Surface Area: 75.00Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.27CX Basic pKa: 7.94CX LogP: 3.87CX LogD: 3.21
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.52

References

1. Wang Y, Liu WJ, Yin L, Li H, Chen ZH, Zhu DX, Song XQ, Cheng ZZ, Song P, Wang Z, Li ZG..  (2018)  Design and synthesis of 4-(2,3-dihydro-1H-benzo[d]pyrrolo[1,2-a]imidazol-7-yl)-N-(5-(piperazin-1-ylmethyl)pyridine-2-yl)pyrimidin-2-amine as a highly potent and selective cyclin-dependent kinases 4 and 6 inhibitors and the discovery of structure-activity relationships.,  28  (5): [PMID:29429832] [10.1016/j.bmcl.2017.12.068]

Source