(S)-2-((cis-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)amino)-3-(4-hydroxyphenyl)propanoic acid

ID: ALA4214689

Max Phase: Preclinical

Molecular Formula: C33H33N5O4

Molecular Weight: 563.66

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@@H](N[C@@H](Cc2ccc(O)cc2)C(=O)O)CC1

Standard InChI:  InChI=1S/C33H33N5O4/c34-31-30-28(22-8-16-27(17-9-22)42-26-4-2-1-3-5-26)19-38(32(30)36-20-35-31)24-12-10-23(11-13-24)37-29(33(40)41)18-21-6-14-25(39)15-7-21/h1-9,14-17,19-20,23-24,29,37,39H,10-13,18H2,(H,40,41)(H2,34,35,36)/t23-,24+,29-/m0/s1

Standard InChI Key:  IVZNWJUHDBLKKT-IRYADYCUSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   10.0565   -9.7593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0554  -10.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7669  -10.9981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7651   -9.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4814   -9.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4863  -10.5825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2742  -10.8322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7581  -10.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2665   -9.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5199   -8.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3280   -8.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5774   -7.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0198   -7.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2098   -7.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9643   -8.1062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2680   -6.3546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0742   -6.1740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6283   -6.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4339   -6.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6827   -5.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1240   -5.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3206   -5.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7627   -8.5189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5367  -11.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9842  -12.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2396  -13.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0474  -13.1801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5997  -12.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3440  -11.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3030  -13.9605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1068  -14.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6547  -13.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4585  -13.6867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3992  -12.7374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3623  -14.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1661  -15.0787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4165  -15.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2193  -16.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7683  -15.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5089  -14.6331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7066  -14.4678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5722  -15.5846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
  4 23  1  0
 24  7  1  1
 24 25  1  0
 24 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  1
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 31 35  1  6
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 39 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4214689

    ---

Associated Targets(Human)

HCK Tclin Tyrosine-protein kinase HCK (2743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FLT3 Tclin Tyrosine-protein kinase receptor FLT3 (13481 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 563.66Molecular Weight (Monoisotopic): 563.2533AlogP: 5.95#Rotatable Bonds: 9
Polar Surface Area: 135.52Molecular Species: ZWITTERIONHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 0.91CX Basic pKa: 10.95CX LogP: 3.25CX LogD: 3.12
Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.22

References

1. Koda Y, Kikuzato K, Mikuni J, Tanaka A, Yuki H, Honma T, Tomabechi Y, Kukimoto-Niino M, Shirouzu M, Shirai F, Koyama H..  (2017)  Identification of pyrrolo[2,3-d]pyrimidines as potent HCK and FLT3-ITD dual inhibitors.,  27  (22): [PMID:29037944] [10.1016/j.bmcl.2017.10.012]

Source