The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((cis-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)amino)-3-(4-hydroxyphenyl)propanoic acid ID: ALA4214689
Max Phase: Preclinical
Molecular Formula: C33H33N5O4
Molecular Weight: 563.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@@H](N[C@@H](Cc2ccc(O)cc2)C(=O)O)CC1
Standard InChI: InChI=1S/C33H33N5O4/c34-31-30-28(22-8-16-27(17-9-22)42-26-4-2-1-3-5-26)19-38(32(30)36-20-35-31)24-12-10-23(11-13-24)37-29(33(40)41)18-21-6-14-25(39)15-7-21/h1-9,14-17,19-20,23-24,29,37,39H,10-13,18H2,(H,40,41)(H2,34,35,36)/t23-,24+,29-/m0/s1
Standard InChI Key: IVZNWJUHDBLKKT-IRYADYCUSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
10.0565 -9.7593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0554 -10.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7669 -10.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7651 -9.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4814 -9.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4863 -10.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2742 -10.8322 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7581 -10.1596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2665 -9.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5199 -8.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3280 -8.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5774 -7.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0198 -7.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2098 -7.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9643 -8.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2680 -6.3546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0742 -6.1740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6283 -6.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4339 -6.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6827 -5.8225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1240 -5.2107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3206 -5.3899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7627 -8.5189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5367 -11.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9842 -12.2289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2396 -13.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0474 -13.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5997 -12.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3440 -11.7758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3030 -13.9605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1068 -14.1294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6547 -13.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4585 -13.6867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3992 -12.7374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3623 -14.9098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1661 -15.0787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4165 -15.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2193 -16.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7683 -15.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5089 -14.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7066 -14.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5722 -15.5846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
4 23 1 0
24 7 1 1
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 1
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
31 35 1 6
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
39 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.66Molecular Weight (Monoisotopic): 563.2533AlogP: 5.95#Rotatable Bonds: 9Polar Surface Area: 135.52Molecular Species: ZWITTERIONHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 0.91CX Basic pKa: 10.95CX LogP: 3.25CX LogD: 3.12Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -0.22
References 1. Koda Y, Kikuzato K, Mikuni J, Tanaka A, Yuki H, Honma T, Tomabechi Y, Kukimoto-Niino M, Shirouzu M, Shirai F, Koyama H.. (2017) Identification of pyrrolo[2,3-d]pyrimidines as potent HCK and FLT3-ITD dual inhibitors., 27 (22): [PMID:29037944 ] [10.1016/j.bmcl.2017.10.012 ]