N-((3-Methoxy-2'-methyl-2,4'-bipyridin-5-yl)methyl)-9H-carbazole-2-carboxamide

ID: ALA4215124

PubChem CID: 145973007

Max Phase: Preclinical

Molecular Formula: C26H22N4O2

Molecular Weight: 422.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CNC(=O)c2ccc3c(c2)[nH]c2ccccc23)cnc1-c1ccnc(C)c1

Standard InChI:  InChI=1S/C26H22N4O2/c1-16-11-18(9-10-27-16)25-24(32-2)12-17(14-28-25)15-29-26(31)19-7-8-21-20-5-3-4-6-22(20)30-23(21)13-19/h3-14,30H,15H2,1-2H3,(H,29,31)

Standard InChI Key:  BLLKBDFOLOWWEK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   17.6920   -8.8735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6909   -9.6930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3989  -10.1020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1086   -9.6926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1057   -8.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3971   -8.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9842   -8.4651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9828  -10.1011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2771   -9.6905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5695  -10.0978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5684  -10.9159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2808  -11.3249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9854  -10.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8623   -9.6883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8119   -8.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5212   -8.8646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2273   -8.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9366   -8.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2242   -7.6361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9365   -9.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6450  -10.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6374   -8.4463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3464   -8.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3518   -9.6695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1256   -8.5896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6127   -9.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1350   -9.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4722  -10.6600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2870  -10.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7633  -10.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4234   -9.3288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2766   -8.8738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 10 14  1  0
  5 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  2  0
 20 21  1  0
 21 24  2  0
 23 22  2  0
 22 18  1  0
 23 24  1  0
 24 27  1  0
 26 25  1  0
 25 23  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  7 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4215124

    ---

Associated Targets(non-human)

Smo Smoothened homolog (1243 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Porcn Probable protein-cysteine N-palmitoyltransferase porcupine (165 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.49Molecular Weight (Monoisotopic): 422.1743AlogP: 5.03#Rotatable Bonds: 5
Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.84CX Basic pKa: 4.64CX LogP: 3.46CX LogD: 3.46
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -0.74

References

1. Ma H, Chen Q, Zhu F, Zheng J, Li J, Zhang H, Chen S, Xing H, Luo L, Zheng LT, He S, Zhang X..  (2018)  Discovery and characterization of a potent Wnt and hedgehog signaling pathways dual inhibitor.,  149  [PMID:29499483] [10.1016/j.ejmech.2018.02.034]

Source