2,4-dimethyl-N-(1-(5-(trifluoromethyl)pyrimidin-2-yl)azetidin-3-yl)quinoline-6-carboxamide

ID: ALA4215358

PubChem CID: 135126256

Max Phase: Preclinical

Molecular Formula: C20H18F3N5O

Molecular Weight: 401.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)c2cc(C(=O)NC3CN(c4ncc(C(F)(F)F)cn4)C3)ccc2n1

Standard InChI:  InChI=1S/C20H18F3N5O/c1-11-5-12(2)26-17-4-3-13(6-16(11)17)18(29)27-15-9-28(10-15)19-24-7-14(8-25-19)20(21,22)23/h3-8,15H,9-10H2,1-2H3,(H,27,29)

Standard InChI Key:  PLKPPGQZOQNCNE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   27.3553    0.2518    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.7680   -0.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1764    0.2575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.8724   -2.8725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8713   -3.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5793   -4.1010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5775   -2.4637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2861   -2.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2869   -3.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9954   -4.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7037   -3.6842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6990   -2.8620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9898   -2.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1632   -4.1001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5751   -1.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4042   -2.4491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1143   -2.8534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3992   -1.6320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8557   -2.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6221   -2.8010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9071   -2.0371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1432   -1.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6227   -1.6426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3242   -2.0690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0394   -1.6752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0560   -0.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3516   -0.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6393   -0.8310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.4712   -0.8835    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5 14  1  0
  7 15  1  0
 12 16  1  0
 16 17  1  0
 16 18  2  0
 19 17  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 19  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26  2  1  0
  2 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4215358

    ---

Associated Targets(non-human)

Chrm4 Muscarinic acetylcholine receptor M4 (559 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.39Molecular Weight (Monoisotopic): 401.1463AlogP: 3.28#Rotatable Bonds: 3
Polar Surface Area: 71.01Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.62CX LogP: 3.28CX LogD: 3.27
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: -1.63

References

1. Long MF, Engers JL, Chang S, Zhan X, Weiner RL, Luscombe VB, Rodriguez AL, Cho HP, Niswender CM, Bridges TM, Conn PJ, Engers DW, Lindsley CW..  (2017)  Discovery of a novel 2,4-dimethylquinoline-6-carboxamide M4 positive allosteric modulator (PAM) chemotype via scaffold hopping.,  27  (22): [PMID:29037946] [10.1016/j.bmcl.2017.10.016]

Source