The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(4-hydroxybiphenyl-3-yl)-3-(2'-((E)-2-(2-methyl-1H-indol-3-yl)vinyl)biphenyl-4-yl)acrylamide ID: ALA4215385
PubChem CID: 145972544
Max Phase: Preclinical
Molecular Formula: C38H30N2O2
Molecular Weight: 546.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c2ccccc2c1/C=C/c1ccccc1-c1ccc(/C=C/C(=O)Nc2cc(-c3ccccc3)ccc2O)cc1
Standard InChI: InChI=1S/C38H30N2O2/c1-26-32(34-13-7-8-14-35(34)39-26)22-20-29-11-5-6-12-33(29)30-18-15-27(16-19-30)17-24-38(42)40-36-25-31(21-23-37(36)41)28-9-3-2-4-10-28/h2-25,39,41H,1H3,(H,40,42)/b22-20+,24-17+
Standard InChI Key: NCIRUGSKZNEFAQ-CVPKWZDJSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
1.9755 -9.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9744 -10.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6866 -10.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4003 -10.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3975 -9.4188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6848 -9.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1048 -9.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8184 -9.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5282 -9.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5256 -8.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8073 -7.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1004 -8.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2354 -7.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9451 -8.1724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6549 -7.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3688 -8.1652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6507 -6.9389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1128 -10.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1141 -11.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8266 -11.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1284 -12.1564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5805 -11.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7209 -12.8689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9196 -12.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3733 -13.3062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6311 -14.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4362 -14.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9749 -13.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7488 -10.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3730 -8.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6628 -9.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6666 -10.2218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3811 -10.6276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0931 -10.2110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0858 -9.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8049 -10.6111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8106 -11.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5251 -11.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2343 -11.4212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2246 -10.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5096 -10.1970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9494 -8.9913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
5 7 1 0
10 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
15 17 2 0
4 18 1 0
18 19 2 0
19 20 1 0
20 24 1 0
23 21 1 0
21 22 1 0
22 20 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
22 29 1 0
16 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
34 36 1 0
31 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.67Molecular Weight (Monoisotopic): 546.2307AlogP: 9.34#Rotatable Bonds: 7Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 2HBD: 3#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.68CX Basic pKa: ┄CX LogP: 9.20CX LogD: 9.18Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.29