(E)-N-(4-hydroxybiphenyl-3-yl)-3-(2'-((E)-2-(2-methyl-1H-indol-3-yl)vinyl)biphenyl-4-yl)acrylamide

ID: ALA4215385

PubChem CID: 145972544

Max Phase: Preclinical

Molecular Formula: C38H30N2O2

Molecular Weight: 546.67

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1[nH]c2ccccc2c1/C=C/c1ccccc1-c1ccc(/C=C/C(=O)Nc2cc(-c3ccccc3)ccc2O)cc1

Standard InChI:  InChI=1S/C38H30N2O2/c1-26-32(34-13-7-8-14-35(34)39-26)22-20-29-11-5-6-12-33(29)30-18-15-27(16-19-30)17-24-38(42)40-36-25-31(21-23-37(36)41)28-9-3-2-4-10-28/h2-25,39,41H,1H3,(H,40,42)/b22-20+,24-17+

Standard InChI Key:  NCIRUGSKZNEFAQ-CVPKWZDJSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
    1.9755   -9.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9744  -10.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6866  -10.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4003  -10.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3975   -9.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6848   -9.0094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1048   -9.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8184   -9.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5282   -9.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5256   -8.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8073   -7.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1004   -8.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2354   -7.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9451   -8.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6549   -7.7602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3688   -8.1652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6507   -6.9389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1128  -10.6531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1141  -11.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8266  -11.8860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1284  -12.1564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5805  -11.5459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7209  -12.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9196  -12.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3733  -13.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6311  -14.0842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4362  -14.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9749  -13.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7488  -10.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3730   -8.9865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6628   -9.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6666  -10.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3811  -10.6276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0931  -10.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0858   -9.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8049  -10.6111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8106  -11.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5251  -11.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2343  -11.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2246  -10.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5096  -10.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9494   -8.9913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 10 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
  4 18  1  0
 18 19  2  0
 19 20  1  0
 20 24  1  0
 23 21  1  0
 21 22  1  0
 22 20  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 29  1  0
 16 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 41 36  1  0
 34 36  1  0
 31 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4215385

    ---

Associated Targets(Human)

LN-18 (85 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
T98G (1524 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 546.67Molecular Weight (Monoisotopic): 546.2307AlogP: 9.34#Rotatable Bonds: 7
Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 2HBD: 3
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.68CX Basic pKa: CX LogP: 9.20CX LogD: 9.18
Aromatic Rings: 6Heavy Atoms: 42QED Weighted: 0.14Np Likeness Score: -0.29

References

1.  (2016)  (12): [10.1039/C6MD00477F]

Source