1-[4-(5-Aminothiazolo[5,4-d]pyrimidin-7-yl)piperazin-1-yl]-2-(3,4-dimethoxyphenyl)ethanone

ID: ALA4215673

PubChem CID: 145973476

Max Phase: Preclinical

Molecular Formula: C19H22N6O3S

Molecular Weight: 414.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CC(=O)N2CCN(c3nc(N)nc4scnc34)CC2)cc1OC

Standard InChI:  InChI=1S/C19H22N6O3S/c1-27-13-4-3-12(9-14(13)28-2)10-15(26)24-5-7-25(8-6-24)17-16-18(29-11-21-16)23-19(20)22-17/h3-4,9,11H,5-8,10H2,1-2H3,(H2,20,22,23)

Standard InChI Key:  YAHULMMYPWZTOQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   40.7467  -22.3118    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7456  -23.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4536  -23.5403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4518  -21.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1604  -22.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1653  -23.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9496  -23.3811    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   43.4296  -22.7123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.9418  -22.0493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.0375  -23.5393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4494  -21.0857    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.1578  -20.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.1573  -19.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4502  -19.4518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7419  -19.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7407  -20.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4508  -18.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.7434  -18.2254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.1558  -18.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8649  -18.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8654  -19.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5737  -19.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2810  -19.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.2756  -18.6222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5667  -18.2198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9906  -19.8489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.9804  -18.2087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.6909  -18.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9945  -20.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  2 10  1  0
  4 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 24 27  1  0
 27 28  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4215673

    ---

Associated Targets(Human)

PI4KB Tchem PI4-kinase beta subunit (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.49Molecular Weight (Monoisotopic): 414.1474AlogP: 1.58#Rotatable Bonds: 5
Polar Surface Area: 106.70Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.35CX LogP: 1.70CX LogD: 1.70
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.13

References

1. Reuberson J, Horsley H, Franklin RJ, Ford D, Neuss J, Brookings D, Huang Q, Vanderhoydonck B, Gao LJ, Jang MY, Herdewijn P, Ghawalkar A, Fallah-Arani F, Khan AR, Henshall J, Jairaj M, Malcolm S, Ward E, Shuttleworth L, Lin Y, Li S, Louat T, Waer M, Herman J, Payne A, Ceska T, Doyle C, Pitt W, Calmiano M, Augustin M, Steinbacher S, Lammens A, Allen R..  (2018)  Discovery of a Potent, Orally Bioavailable PI4KIIIβ Inhibitor (UCB9608) Able To Significantly Prolong Allogeneic Organ Engraftment in Vivo.,  61  (15): [PMID:29952567] [10.1021/acs.jmedchem.8b00521]

Source