The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-methoxyphenyl)-4-(3-(methylphenylacetate-4-yl-oxy)-2-hydroxypropyl)-piperazine ID: ALA4215889
PubChem CID: 145971621
Max Phase: Preclinical
Molecular Formula: C23H30N2O5
Molecular Weight: 414.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cc1ccc(OCC(O)CN2CCN(c3ccccc3OC)CC2)cc1
Standard InChI: InChI=1S/C23H30N2O5/c1-28-22-6-4-3-5-21(22)25-13-11-24(12-14-25)16-19(26)17-30-20-9-7-18(8-10-20)15-23(27)29-2/h3-10,19,26H,11-17H2,1-2H3
Standard InChI Key: QBMBZYSVGFDWTF-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
11.9923 -2.7817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9912 -3.6013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6992 -4.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4089 -3.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4060 -2.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6974 -2.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6950 -1.5557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4015 -1.1450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1104 -1.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8169 -1.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1128 -2.3686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5258 -1.5472 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5227 -2.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2275 -2.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9364 -2.3606 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9359 -1.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2266 -1.1315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6425 -2.7693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6405 -3.5876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3470 -3.9967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0561 -3.5886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0541 -2.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3470 -2.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6990 -4.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9912 -5.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9910 -6.0530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2836 -4.8271 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5758 -5.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9320 -3.9949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2251 -3.5850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
3 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
19 29 1 0
29 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.50Molecular Weight (Monoisotopic): 414.2155AlogP: 1.97#Rotatable Bonds: 9Polar Surface Area: 71.47Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.25CX LogP: 2.57CX LogD: 2.33Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.63Np Likeness Score: -1.02
References 1. Huang JJ, Zhang ZH, He F, Liu XW, Xu XJ, Dai LJ, Liu QM, Yuan M.. (2018) Novel naftopidil derivatives containing methyl phenylacetate and their blocking effects on α1D/1A-adrenoreceptor subtypes., 28 (4): [PMID:29422390 ] [10.1016/j.bmcl.2018.01.068 ]