The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tabernaemontanine(3'-bromobenzylidene)hydrazone ID: ALA4215945
PubChem CID: 145973948
Max Phase: Preclinical
Molecular Formula: C28H31BrN4O2
Molecular Weight: 535.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1CN(C)[C@H]2Cc3c([nH]c4ccccc34)/C(=N/N=C\c3cccc(Br)c3)C[C@H]1[C@H]2C(=O)OC
Standard InChI: InChI=1S/C28H31BrN4O2/c1-4-18-16-33(2)25-14-22-20-10-5-6-11-23(20)31-27(22)24(13-21(18)26(25)28(34)35-3)32-30-15-17-8-7-9-19(29)12-17/h5-12,15,18,21,25-26,31H,4,13-14,16H2,1-3H3/b30-15-,32-24+/t18-,21-,25+,26-/m1/s1
Standard InChI Key: RAGLDRACJXKGDB-KFOXFPIQSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
14.4465 -14.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0241 -14.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7392 -14.5131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4499 -13.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0241 -13.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7392 -12.8596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7340 -12.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0156 -11.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3040 -13.6863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3038 -12.8734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2970 -12.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5215 -13.1343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0338 -12.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5094 -11.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1685 -11.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3479 -10.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8694 -11.6466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2175 -12.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7172 -14.2687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7127 -15.0999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4239 -15.5127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4165 -16.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1312 -16.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8522 -16.3443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8539 -15.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1386 -15.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1397 -15.2244 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.3397 -11.4550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7343 -10.7310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5563 -10.7093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3066 -10.0288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9839 -11.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5130 -11.2416 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.9618 -12.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1533 -14.5139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8616 -14.1067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1263 -17.5813 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
3 1 1 0
1 4 1 0
4 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 11 1 0
5 9 2 0
10 11 2 0
11 14 1 0
13 12 1 0
12 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
3 27 1 6
3 28 1 0
7 28 1 0
28 29 1 6
29 30 1 0
29 31 2 0
30 32 1 0
7 33 1 6
6 34 1 0
1 35 1 1
35 36 1 0
23 37 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.49Molecular Weight (Monoisotopic): 534.1630AlogP: 5.45#Rotatable Bonds: 4Polar Surface Area: 70.05Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.57CX Basic pKa: 8.46CX LogP: 5.18CX LogD: 4.09Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: 0.32
References 1. Paterna A, Khonkarn R, Mulhovo S, Moreno A, Madeira Girio P, Baubichon-Cortay H, Falson P, Ferreira MU.. (2018) Monoterpene indole alkaloid azine derivatives as MDR reversal agents., 26 (2): [PMID:29233614 ] [10.1016/j.bmc.2017.11.052 ]