4-((2-(5-Isopropyl-1,2,4-oxadiazol-3-yl)-3-methylbenzo[b]thiophen-6-yl)oxy)-N-methylpicolinamide

ID: ALA4215952

PubChem CID: 138549841

Max Phase: Preclinical

Molecular Formula: C21H20N4O3S

Molecular Weight: 408.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(Oc2ccc3c(C)c(-c4noc(C(C)C)n4)sc3c2)ccn1

Standard InChI:  InChI=1S/C21H20N4O3S/c1-11(2)21-24-19(25-28-21)18-12(3)15-6-5-13(10-17(15)29-18)27-14-7-8-23-16(9-14)20(26)22-4/h5-11H,1-4H3,(H,22,26)

Standard InChI Key:  OFCQOJNWCUVGKM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   32.1951   -9.3069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1939  -10.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9020  -10.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6117  -10.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6088   -9.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9002   -8.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4859  -10.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7785  -10.1253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4853  -11.3516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.0705  -10.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3200  -10.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0271  -10.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7321  -10.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7245   -8.8972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0208   -9.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4378   -9.3045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4370  -10.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2111  -10.3712    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.6904   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2124   -9.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4657   -8.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5076   -9.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9890  -10.3733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7664  -10.1215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7672   -9.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.9903   -9.0511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4271  -10.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3409  -11.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1739  -10.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
  4 11  1  0
 11 12  1  0
 12 13  2  0
 13 17  1  0
 16 14  1  0
 14 15  2  0
 15 12  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 20 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 22  2  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4215952

    ---

Associated Targets(Human)

H1-HeLa (123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

rhinovirus B14 (1052 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
rhinovirus A21 (119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 408.48Molecular Weight (Monoisotopic): 408.1256AlogP: 4.93#Rotatable Bonds: 5
Polar Surface Area: 90.14Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 14.00CX Basic pKa: 3.02CX LogP: 4.43CX LogD: 4.43
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.42

References

1. Kim J, Shin JS, Ahn S, Han SB, Jung YS..  (2018)  3-Aryl-1,2,4-oxadiazole Derivatives Active Against Human Rhinovirus.,  (7): [PMID:30034598] [10.1021/acsmedchemlett.8b00134]

Source