4-(5-Aminothiazolo[5,4-d]pyrimidin-7-yl)-N-(6-methoxy-2-methyl-3-pyridyl)piperazine-1-carboxamide

ID: ALA4216301

PubChem CID: 145974197

Max Phase: Preclinical

Molecular Formula: C17H20N8O2S

Molecular Weight: 400.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)N2CCN(c3nc(N)nc4scnc34)CC2)c(C)n1

Standard InChI:  InChI=1S/C17H20N8O2S/c1-10-11(3-4-12(20-10)27-2)21-17(26)25-7-5-24(6-8-25)14-13-15(28-9-19-13)23-16(18)22-14/h3-4,9H,5-8H2,1-2H3,(H,21,26)(H2,18,22,23)

Standard InChI Key:  FXHQAAGCIBZXGI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   14.4728   -5.9102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4716   -6.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1797   -7.1387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1779   -5.5013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8865   -5.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8913   -6.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6757   -6.9795    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.1557   -6.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6679   -5.6477    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7636   -7.1377    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1754   -4.6841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8838   -4.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8833   -3.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1762   -3.0502    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4679   -3.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4668   -4.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1769   -2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4695   -1.8238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8849   -1.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5923   -2.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5881   -3.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2946   -3.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0036   -3.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0016   -2.2307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2945   -1.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2918   -1.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7115   -3.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.7120   -4.2775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  2 10  1  0
  4 11  1  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 23 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4216301

    ---

Associated Targets(Human)

PI4KB Tchem PI4-kinase beta subunit (1593 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.47Molecular Weight (Monoisotopic): 400.1430AlogP: 1.73#Rotatable Bonds: 3
Polar Surface Area: 122.39Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.45CX Basic pKa: 4.37CX LogP: 1.44CX LogD: 1.44
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.68Np Likeness Score: -1.82

References

1. Reuberson J, Horsley H, Franklin RJ, Ford D, Neuss J, Brookings D, Huang Q, Vanderhoydonck B, Gao LJ, Jang MY, Herdewijn P, Ghawalkar A, Fallah-Arani F, Khan AR, Henshall J, Jairaj M, Malcolm S, Ward E, Shuttleworth L, Lin Y, Li S, Louat T, Waer M, Herman J, Payne A, Ceska T, Doyle C, Pitt W, Calmiano M, Augustin M, Steinbacher S, Lammens A, Allen R..  (2018)  Discovery of a Potent, Orally Bioavailable PI4KIIIβ Inhibitor (UCB9608) Able To Significantly Prolong Allogeneic Organ Engraftment in Vivo.,  61  (15): [PMID:29952567] [10.1021/acs.jmedchem.8b00521]

Source