The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tabernaemontanine(2',2'-dimethylpropylidene)hydrazone ID: ALA4216422
PubChem CID: 145971395
Max Phase: Preclinical
Molecular Formula: C26H36N4O2
Molecular Weight: 436.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1CN(C)[C@H]2Cc3c([nH]c4ccccc34)/C(=N/N=C\C(C)(C)C)C[C@H]1[C@H]2C(=O)OC
Standard InChI: InChI=1S/C26H36N4O2/c1-7-16-14-30(5)22-13-19-17-10-8-9-11-20(17)28-24(19)21(29-27-15-26(2,3)4)12-18(16)23(22)25(31)32-6/h8-11,15-16,18,22-23,28H,7,12-14H2,1-6H3/b27-15-,29-21+/t16-,18-,22+,23-/m1/s1
Standard InChI Key: KTNHPEAXZCBPDP-NMQOHJNXSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
13.6494 -6.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2310 -6.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9487 -6.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6529 -5.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2310 -5.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9487 -4.9156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9435 -4.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2225 -3.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5128 -5.7407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5126 -4.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5058 -4.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7321 -5.1867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2470 -4.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7199 -3.8526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3822 -3.1104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5588 -3.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0830 -3.7027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4325 -4.4466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9240 -6.3207 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.9196 -7.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6331 -7.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3462 -7.2797 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.5424 -3.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9426 -2.7885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7632 -2.7667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5136 -2.0883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1878 -3.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7171 -3.3008 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.1730 -4.7773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3587 -6.5668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0650 -6.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6296 -8.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3458 -7.1566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3380 -7.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
3 1 1 0
1 4 1 0
4 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 11 1 0
5 9 2 0
10 11 2 0
11 14 1 0
13 12 1 0
12 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 19 1 0
19 20 2 0
20 21 1 0
3 22 1 6
3 23 1 0
7 23 1 0
23 24 1 6
24 25 1 0
24 26 2 0
25 27 1 0
7 28 1 6
6 29 1 0
1 30 1 1
30 31 1 0
21 32 1 0
21 33 1 0
21 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.60Molecular Weight (Monoisotopic): 436.2838AlogP: 4.68#Rotatable Bonds: 3Polar Surface Area: 70.05Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.57CX Basic pKa: 8.46CX LogP: 4.14CX LogD: 3.05Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: 0.79
References 1. Paterna A, Khonkarn R, Mulhovo S, Moreno A, Madeira Girio P, Baubichon-Cortay H, Falson P, Ferreira MU.. (2018) Monoterpene indole alkaloid azine derivatives as MDR reversal agents., 26 (2): [PMID:29233614 ] [10.1016/j.bmc.2017.11.052 ]