The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5,7-dimethoxy-2-(4-methoxyphenyl)-4-oxoquinolin-1(4H)-ylsulfonyl)benzonitrile ID: ALA4216565
PubChem CID: 145973973
Max Phase: Preclinical
Molecular Formula: C25H20N2O6S
Molecular Weight: 476.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(=O)c3c(OC)cc(OC)cc3n2S(=O)(=O)c2ccc(C#N)cc2)cc1
Standard InChI: InChI=1S/C25H20N2O6S/c1-31-18-8-6-17(7-9-18)21-14-23(28)25-22(12-19(32-2)13-24(25)33-3)27(21)34(29,30)20-10-4-16(15-26)5-11-20/h4-14H,1-3H3
Standard InChI Key: FJBQQVSXHLRHTH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
36.9222 -2.5011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.5177 -3.2110 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
37.3347 -3.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4073 -4.4491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4061 -5.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1142 -5.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1124 -4.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8210 -4.4455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8244 -5.2662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5328 -5.6713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2425 -5.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2391 -4.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5261 -4.0300 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5350 -6.4885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9443 -4.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6535 -4.4377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3595 -4.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3574 -3.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6435 -2.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9404 -3.2158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0633 -2.7978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7728 -3.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6995 -4.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1147 -6.4948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4073 -6.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9919 -4.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8117 -2.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8097 -1.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1005 -1.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3941 -1.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4013 -2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1109 -3.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6836 -1.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9730 -1.1950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
10 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
12 15 1 0
18 21 1 0
21 22 1 0
4 23 1 0
6 24 1 0
24 25 1 0
23 26 1 0
13 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.51Molecular Weight (Monoisotopic): 476.1042AlogP: 3.80#Rotatable Bonds: 6Polar Surface Area: 107.62Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.22CX LogD: 3.22Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.63
References 1. Ling T, Lang W, Feng X, Das S, Maier J, Jeffries C, Shelat A, Rivas F.. (2018) Novel vitexin-inspired scaffold against leukemia., 146 [PMID:29407975 ] [10.1016/j.ejmech.2018.01.004 ]