The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-4-((8-methoxy-2,5-dioxo-3-(pyridin-3-ylmethyl)-2,3-dihydro-1H-benzo[e][1,4]diazepin-4(5H)-yl)methyl)benzoic acid ID: ALA4216568
PubChem CID: 132213694
Max Phase: Preclinical
Molecular Formula: C24H21N3O5
Molecular Weight: 431.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)NC(=O)[C@@H](Cc1cccnc1)N(Cc1ccc(C(=O)O)cc1)C2=O
Standard InChI: InChI=1S/C24H21N3O5/c1-32-18-8-9-19-20(12-18)26-22(28)21(11-16-3-2-10-25-13-16)27(23(19)29)14-15-4-6-17(7-5-15)24(30)31/h2-10,12-13,21H,11,14H2,1H3,(H,26,28)(H,30,31)/t21-/m1/s1
Standard InChI Key: XRYGRSKGVCWFDF-OAQYLSRUSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.5079 -9.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5079 -10.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2224 -10.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2224 -9.1267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9368 -10.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9368 -9.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5818 -9.0248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.5818 -10.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3861 -9.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3861 -10.6950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7441 -9.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9005 -8.5634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3983 -11.6829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5691 -9.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9816 -10.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9005 -11.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5991 -12.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1135 -12.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8121 -13.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9963 -13.6439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4819 -12.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7833 -12.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6949 -14.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8791 -14.5349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2093 -15.0569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8066 -10.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2191 -11.3807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8066 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9816 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5691 -11.3807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7934 -9.1267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7934 -8.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 5 2 0
6 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
5 8 1 0
7 9 1 0
8 10 1 0
9 11 1 0
10 11 1 0
9 12 2 0
8 13 2 0
11 14 1 1
14 15 1 0
10 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
23 25 2 0
15 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 15 1 0
1 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.45Molecular Weight (Monoisotopic): 431.1481AlogP: 2.99#Rotatable Bonds: 6Polar Surface Area: 108.83Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.01CX Basic pKa: 4.98CX LogP: 2.21CX LogD: 0.07Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -0.38
References 1. Letourneau JJ, Stroke IL, Hilbert DW, Sturzenbecker LJ, Marinelli BA, Quintero JG, Sabalski J, Ma L, Diller DJ, Stein PD, Webb ML.. (2018) Identification and initial optimization of inhibitors of Clostridium difficile (C. difficile) toxin B (TcdB)., 28 (4): [PMID:29331267 ] [10.1016/j.bmcl.2018.01.005 ]