The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tabernaemontanine(4'-hydroxy-3'-methoxybenzylidene)hydrazone ID: ALA4216655
PubChem CID: 145973976
Max Phase: Preclinical
Molecular Formula: C29H34N4O4
Molecular Weight: 502.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@H]1CN(C)[C@H]2Cc3c([nH]c4ccccc34)/C(=N/N=C\c3ccc(O)c(OC)c3)C[C@H]1[C@H]2C(=O)OC
Standard InChI: InChI=1S/C29H34N4O4/c1-5-18-16-33(2)24-14-21-19-8-6-7-9-22(19)31-28(21)23(13-20(18)27(24)29(35)37-4)32-30-15-17-10-11-25(34)26(12-17)36-3/h6-12,15,18,20,24,27,31,34H,5,13-14,16H2,1-4H3/b30-15-,32-23+/t18-,20-,24+,27-/m1/s1
Standard InChI Key: SPGGMUWGQXRFQX-YTKCTSSESA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
15.4348 -23.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0164 -23.9851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7317 -24.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4382 -23.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0164 -23.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7317 -22.7434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7265 -21.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0079 -21.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2961 -23.5653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2960 -22.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2891 -21.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5139 -23.0164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0290 -22.3519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5018 -21.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1629 -20.9330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3428 -20.8490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8626 -21.5287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2131 -22.2746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7084 -24.1486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7040 -24.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4152 -25.3941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4081 -26.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1229 -26.6324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8441 -26.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8457 -25.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1302 -24.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1299 -25.1031 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.3288 -21.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7252 -20.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5468 -20.5926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2957 -19.9117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9720 -21.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5025 -21.1262 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.9545 -22.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1418 -24.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8504 -23.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5605 -26.6406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1180 -27.4593 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3988 -27.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 2 1 0
2 3 1 0
3 1 1 0
1 4 1 0
4 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 11 1 0
5 9 2 0
10 11 2 0
11 14 1 0
13 12 1 0
12 10 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
9 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
3 27 1 6
3 28 1 0
7 28 1 0
28 29 1 6
29 30 1 0
29 31 2 0
30 32 1 0
7 33 1 6
6 34 1 0
1 35 1 1
35 36 1 0
24 37 1 0
23 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.62Molecular Weight (Monoisotopic): 502.2580AlogP: 4.40#Rotatable Bonds: 5Polar Surface Area: 99.51Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.42CX Basic pKa: 9.55CX LogP: 3.73CX LogD: 2.86Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.31Np Likeness Score: 0.68
References 1. Paterna A, Khonkarn R, Mulhovo S, Moreno A, Madeira Girio P, Baubichon-Cortay H, Falson P, Ferreira MU.. (2018) Monoterpene indole alkaloid azine derivatives as MDR reversal agents., 26 (2): [PMID:29233614 ] [10.1016/j.bmc.2017.11.052 ]