The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(cis-4-(4-amino-5-(4-phenoxyphenyl)-7H-pyrrolo[2,3-d]pyrimidin-7-yl)cyclohexyl)pyrrolidine-2-carboxylic acid ID: ALA4216680
Max Phase: Preclinical
Molecular Formula: C29H31N5O3
Molecular Weight: 497.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@H]1CC[C@@H](N2CCC[C@@H]2C(=O)O)CC1
Standard InChI: InChI=1S/C29H31N5O3/c30-27-26-24(19-8-14-23(15-9-19)37-22-5-2-1-3-6-22)17-34(28(26)32-18-31-27)21-12-10-20(11-13-21)33-16-4-7-25(33)29(35)36/h1-3,5-6,8-9,14-15,17-18,20-21,25H,4,7,10-13,16H2,(H,35,36)(H2,30,31,32)/t20-,21+,25-/m1/s1
Standard InChI Key: DORRCVAXQFZOLU-TYBLODHISA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
10.0533 -9.7562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0522 -10.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7635 -10.9946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7617 -9.3413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4778 -9.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4826 -10.5791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2703 -10.8287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7540 -10.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2626 -9.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5159 -8.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3238 -8.5327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5730 -7.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0156 -7.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2059 -7.3183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9605 -8.1036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2638 -6.3526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0697 -6.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6236 -6.7841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4289 -6.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6777 -5.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1191 -5.2091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3160 -5.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7593 -8.5162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5327 -11.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9804 -12.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2357 -13.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0433 -13.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5953 -12.5590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3397 -11.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2988 -13.9561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8223 -14.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3064 -15.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0867 -15.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0846 -14.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7474 -13.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4984 -14.0565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6594 -12.9084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
13 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
4 23 1 0
24 7 1 1
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
27 30 1 1
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
34 35 1 1
35 36 1 0
35 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.60Molecular Weight (Monoisotopic): 497.2427AlogP: 5.51#Rotatable Bonds: 6Polar Surface Area: 106.50Molecular Species: ZWITTERIONHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 0.89CX Basic pKa: 11.08CX LogP: 2.13CX LogD: 1.94Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -0.35
References 1. Koda Y, Kikuzato K, Mikuni J, Tanaka A, Yuki H, Honma T, Tomabechi Y, Kukimoto-Niino M, Shirouzu M, Shirai F, Koyama H.. (2017) Identification of pyrrolo[2,3-d]pyrimidines as potent HCK and FLT3-ITD dual inhibitors., 27 (22): [PMID:29037944 ] [10.1016/j.bmcl.2017.10.012 ]