3,3-dimethyl-6-(2-methylpyrimidin-5-yl)-1-(6-(pyrrolidin-1-yl)pyrazin-2-yl)indolin-2-one

ID: ALA4216732

PubChem CID: 129104160

Max Phase: Preclinical

Molecular Formula: C23H24N6O

Molecular Weight: 400.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc(-c2ccc3c(c2)N(c2cncc(N4CCCC4)n2)C(=O)C3(C)C)cn1

Standard InChI:  InChI=1S/C23H24N6O/c1-15-25-11-17(12-26-15)16-6-7-18-19(10-16)29(22(30)23(18,2)3)21-14-24-13-20(27-21)28-8-4-5-9-28/h6-7,10-14H,4-5,8-9H2,1-3H3

Standard InChI Key:  BZFAIJMAGVZQDA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    6.4632  -15.3781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4674  -16.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1730  -15.7831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2744  -16.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2732  -17.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9813  -17.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9795  -16.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5671  -17.6872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8594  -17.2763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1519  -17.6837    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1508  -18.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8632  -18.9108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5678  -18.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6881  -16.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6930  -17.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4773  -17.5287    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9573  -16.8599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7745  -16.8547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4622  -18.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7455  -18.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7302  -19.5573    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4308  -19.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1483  -19.5797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1601  -18.7647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8463  -19.9982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4433  -18.9107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9200  -20.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7132  -20.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1317  -20.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5971  -19.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6 15  2  0
 14  7  2  0
  7  4  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17  2  1  0
  2 14  1  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 16 19  1  0
 23 25  1  0
 11 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4216732

    ---

Associated Targets(non-human)

Slc29a1 Equilibrative nucleoside transporter 1 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.49Molecular Weight (Monoisotopic): 400.2012AlogP: 3.80#Rotatable Bonds: 3
Polar Surface Area: 75.11Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.22CX LogP: 3.36CX LogD: 3.36
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -0.84

References

1. Rosse G..  (2017)  Indolinone Inhibitors of ENT1 for the Treatment of Schizophrenia.,  (10): [PMID:29057039] [10.1021/acsmedchemlett.7b00378]

Source